4-[[(2S,4aR,8S,8aS)-4,4,7,8a-tetramethyl-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-1,2,3,4a,5,8-hexahydronaphthalen-2-yl]oxy]-4-oxobutanoic acid
| Internal ID | 7198ee50-ff08-4bbd-b942-13be47fe20dc |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
| IUPAC Name | 4-[[(2S,4aR,8S,8aS)-4,4,7,8a-tetramethyl-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-1,2,3,4a,5,8-hexahydronaphthalen-2-yl]oxy]-4-oxobutanoic acid |
| SMILES (Canonical) | CC1=CCC2C(CC(CC2(C1CCC3=CC(=O)OC3)C)OC(=O)CCC(=O)O)(C)C |
| SMILES (Isomeric) | CC1=CC[C@H]2[C@@]([C@H]1CCC3=CC(=O)OC3)(C[C@H](CC2(C)C)OC(=O)CCC(=O)O)C |
| InChI | InChI=1S/C24H34O6/c1-15-5-8-19-23(2,3)12-17(30-21(27)10-9-20(25)26)13-24(19,4)18(15)7-6-16-11-22(28)29-14-16/h5,11,17-19H,6-10,12-14H2,1-4H3,(H,25,26)/t17-,18-,19+,24+/m0/s1 |
| InChI Key | DJNBAZMKPVTPNB-YBJWPOLQSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.23553880 g/mol |
| Topological Polar Surface Area (TPSA) | 89.90 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.33% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.82% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.55% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.27% | 86.33% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.41% | 96.47% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.16% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.77% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.74% | 94.45% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.33% | 91.19% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.77% | 94.62% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 84.94% | 94.23% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.69% | 99.23% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.02% | 92.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.87% | 99.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.10% | 97.25% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 81.99% | 96.25% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.26% | 90.17% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.47% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Baccharis pteronioides |
| PubChem | 162886960 |
| LOTUS | LTS0085262 |
| wikiData | Q104982448 |