[2-Hex-3-enoyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropyl] dodecanoate
Internal ID | 50baade1-41cc-4ea9-80d5-33950eac349b |
Taxonomy | Lipids and lipid-like molecules > Glycerolipids > Glycosylglycerols > Glycosyldiacylglycerols |
IUPAC Name | [2-hex-3-enoyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropyl] dodecanoate |
SMILES (Canonical) | CCCCCCCCCCCC(=O)OCC(COC1C(C(C(C(O1)COC2C(C(C(C(O2)CO)O)O)O)O)O)O)OC(=O)CC=CCC |
SMILES (Isomeric) | CCCCCCCCCCCC(=O)OCC(COC1C(C(C(C(O1)COC2C(C(C(C(O2)CO)O)O)O)O)O)O)OC(=O)CC=CCC |
InChI | InChI=1S/C33H58O15/c1-3-5-7-8-9-10-11-12-14-15-24(35)43-18-21(46-25(36)16-13-6-4-2)19-44-32-31(42)29(40)27(38)23(48-32)20-45-33-30(41)28(39)26(37)22(17-34)47-33/h6,13,21-23,26-34,37-42H,3-5,7-12,14-20H2,1-2H3 |
InChI Key | WMXPZMBCAXYUAO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H58O15 |
Molecular Weight | 694.80 g/mol |
Exact Mass | 694.37757114 g/mol |
Topological Polar Surface Area (TPSA) | 231.00 Ų |
XlogP | 2.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.39% | 99.17% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 97.32% | 85.94% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.23% | 96.09% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 96.11% | 92.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.95% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.11% | 98.95% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.99% | 97.29% |
CHEMBL299 | P17252 | Protein kinase C alpha | 90.98% | 98.03% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 90.39% | 83.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.16% | 96.61% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 88.51% | 92.08% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.32% | 96.47% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.39% | 94.73% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 87.15% | 95.17% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 86.91% | 92.32% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.70% | 96.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.50% | 92.86% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.54% | 97.25% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.08% | 100.00% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 84.69% | 82.50% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 84.57% | 97.79% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.38% | 93.56% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.88% | 100.00% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 82.80% | 91.81% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.51% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.89% | 96.95% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.19% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
PubChem | 85165479 |
LOTUS | LTS0130911 |
wikiData | Q105308907 |