[(6Z,10Z)-9-acetyloxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 3-acetyloxy-2-hydroxy-2-methylbutanoate
| Internal ID | 5f3962ff-679b-4204-a7fa-3ab0a6c06569 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Germacranolides and derivatives |
| IUPAC Name | [(6Z,10Z)-9-acetyloxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 3-acetyloxy-2-hydroxy-2-methylbutanoate |
| SMILES (Canonical) | CC1=CCC(C(=CC2C(C(C1)OC(=O)C(C)(C(C)OC(=O)C)O)C(=C)C(=O)O2)C)OC(=O)C |
| SMILES (Isomeric) | C/C/1=C/CC(/C(=C\C2C(C(C1)OC(=O)C(C)(C(C)OC(=O)C)O)C(=C)C(=O)O2)/C)OC(=O)C |
| InChI | InChI=1S/C24H32O9/c1-12-8-9-18(31-17(6)26)13(2)11-20-21(14(3)22(27)32-20)19(10-12)33-23(28)24(7,29)15(4)30-16(5)25/h8,11,15,18-21,29H,3,9-10H2,1-2,4-7H3/b12-8-,13-11- |
| InChI Key | MDEMWAXREYWVBU-SWVSOIPVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H32O9 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.20463259 g/mol |
| Topological Polar Surface Area (TPSA) | 125.00 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
![2D Structure of [(6Z,10Z)-9-acetyloxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 3-acetyloxy-2-hydroxy-2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/9482b150-86b4-11ee-b5cc-c392be1682fb.jpg "2D Structure of [(6Z,10Z)-9-acetyloxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 3-acetyloxy-2-hydroxy-2-methylbutanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.74% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.22% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.23% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.56% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.67% | 94.73% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.91% | 93.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.99% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.71% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.76% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.57% | 86.33% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.53% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.42% | 89.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.72% | 97.14% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.30% | 97.33% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 82.07% | 97.79% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.94% | 95.89% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.88% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ursinia anthemoides |
| Ursinia speciosa |
| PubChem | 90473746 |
| LOTUS | LTS0174397 |
| wikiData | Q104401866 |