[(1S,2R,5R,6S,9R,10S,11S,15S,16S,17R)-15-acetyloxy-6-chloro-9-hydroxy-2,11,15-trimethyl-7-methylidene-3,14-dioxo-4,18-dioxatetracyclo[8.7.1.01,5.011,16]octadec-12-en-17-yl] 2-hydroxyacetate
| Internal ID | 5c6cb459-de72-4791-b9dd-e29c99089934 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
| IUPAC Name | [(1S,2R,5R,6S,9R,10S,11S,15S,16S,17R)-15-acetyloxy-6-chloro-9-hydroxy-2,11,15-trimethyl-7-methylidene-3,14-dioxo-4,18-dioxatetracyclo[8.7.1.01,5.011,16]octadec-12-en-17-yl] 2-hydroxyacetate |
| SMILES (Canonical) | CC1C(=O)OC2C13C(C4C(C=CC(=O)C4(C)OC(=O)C)(C(O3)C(CC(=C)C2Cl)O)C)OC(=O)CO |
| SMILES (Isomeric) | C[C@H]1C(=O)O[C@@H]2[C@@]13[C@@H]([C@@H]4[C@](C=CC(=O)[C@@]4(C)OC(=O)C)([C@H](O3)[C@@H](CC(=C)[C@@H]2Cl)O)C)OC(=O)CO |
| InChI | InChI=1S/C24H29ClO10/c1-10-8-13(28)18-22(4)7-6-14(29)23(5,34-12(3)27)17(22)20(32-15(30)9-26)24(35-18)11(2)21(31)33-19(24)16(10)25/h6-7,11,13,16-20,26,28H,1,8-9H2,2-5H3/t11-,13+,16-,17+,18+,19-,20+,22-,23+,24+/m0/s1 |
| InChI Key | UGMOKXHYLFTUHH-MVTOMYLDSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C24H29ClO10 |
| Molecular Weight | 512.90 g/mol |
| Exact Mass | 512.1449248 g/mol |
| Topological Polar Surface Area (TPSA) | 146.00 Ų |
| XlogP | 0.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.12% | 85.14% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 96.07% | 97.79% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.56% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.54% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.34% | 97.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.06% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.52% | 94.45% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.67% | 89.63% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 89.38% | 97.63% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.32% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.21% | 91.19% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.08% | 91.24% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.34% | 91.07% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.32% | 97.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.86% | 91.49% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.85% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.45% | 95.89% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 84.82% | 98.03% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.60% | 89.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.84% | 89.34% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.59% | 86.92% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.15% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.42% | 94.73% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.79% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162848451 |
| LOTUS | LTS0084211 |
| wikiData | Q105272434 |