(2S,3R)-2-(2,3-dihydroxyphenyl)-3,5,7-trihydroxy-2-[(6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-3H-chromen-4-one
Internal ID | 13b24e23-dfb2-4154-85f4-c3862eb3301e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (2S,3R)-2-(2,3-dihydroxyphenyl)-3,5,7-trihydroxy-2-[(6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-3H-chromen-4-one |
SMILES (Canonical) | CC(=CCCC(=CCCC(=CCC1(C(C(=O)C2=C(C=C(C=C2O1)O)O)O)C3=C(C(=CC=C3)O)O)C)C)C |
SMILES (Isomeric) | CC(=CCC/C(=C/CCC(=CC[C@@]1([C@H](C(=O)C2=C(C=C(C=C2O1)O)O)O)C3=C(C(=CC=C3)O)O)C)/C)C |
InChI | InChI=1S/C30H36O7/c1-18(2)8-5-9-19(3)10-6-11-20(4)14-15-30(22-12-7-13-23(32)27(22)34)29(36)28(35)26-24(33)16-21(31)17-25(26)37-30/h7-8,10,12-14,16-17,29,31-34,36H,5-6,9,11,15H2,1-4H3/b19-10+,20-14?/t29-,30-/m0/s1 |
InChI Key | JAKJQYYMYOIRIK-AIAQCMGWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H36O7 |
Molecular Weight | 508.60 g/mol |
Exact Mass | 508.24610348 g/mol |
Topological Polar Surface Area (TPSA) | 127.00 Ų |
XlogP | 7.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.93% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 96.75% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.39% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.66% | 95.56% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.15% | 93.99% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.95% | 96.09% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.67% | 92.08% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 90.54% | 96.12% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.24% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.11% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.26% | 99.23% |
CHEMBL240 | Q12809 | HERG | 85.10% | 89.76% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.89% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.79% | 90.71% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.78% | 83.10% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.13% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.71% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.40% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.34% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Morus notabilis |
PubChem | 162984551 |
LOTUS | LTS0138071 |
wikiData | Q105123813 |