13-(5-Bromopent-4-ynyl)-7,12,17-trimethyl-3,6,9,16-tetra(propan-2-yl)-4,14-dioxa-1,7,10,17-tetrazabicyclo[17.3.0]docosane-2,5,8,11,15,18-hexone
| Internal ID | fbd6d4b5-aeb4-4076-971d-909545af7382 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 13-(5-bromopent-4-ynyl)-7,12,17-trimethyl-3,6,9,16-tetra(propan-2-yl)-4,14-dioxa-1,7,10,17-tetrazabicyclo[17.3.0]docosane-2,5,8,11,15,18-hexone |
| SMILES (Canonical) | CC1C(OC(=O)C(N(C(=O)C2CCCN2C(=O)C(OC(=O)C(N(C(=O)C(NC1=O)C(C)C)C)C(C)C)C(C)C)C)C(C)C)CCCC#CBr |
| SMILES (Isomeric) | CC1C(OC(=O)C(N(C(=O)C2CCCN2C(=O)C(OC(=O)C(N(C(=O)C(NC1=O)C(C)C)C)C(C)C)C(C)C)C)C(C)C)CCCC#CBr |
| InChI | InChI=1S/C36H57BrN4O8/c1-20(2)27-33(44)40(11)29(22(5)6)36(47)49-30(23(7)8)34(45)41-19-15-16-25(41)32(43)39(10)28(21(3)4)35(46)48-26(17-13-12-14-18-37)24(9)31(42)38-27/h20-30H,12-13,15-17,19H2,1-11H3,(H,38,42) |
| InChI Key | UQYHDSHIIDYSSP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C36H57BrN4O8 |
| Molecular Weight | 753.80 g/mol |
| Exact Mass | 752.33598 g/mol |
| Topological Polar Surface Area (TPSA) | 143.00 Ų |
| XlogP | 6.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.15% | 98.95% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 98.78% | 96.31% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 98.26% | 90.08% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.59% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.65% | 97.25% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 96.26% | 94.66% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 96.14% | 99.18% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 94.90% | 91.76% |
| CHEMBL3837 | P07711 | Cathepsin L | 94.79% | 96.61% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.72% | 95.56% |
| CHEMBL228 | P31645 | Serotonin transporter | 92.53% | 95.51% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 91.81% | 82.38% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 91.28% | 92.12% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.68% | 85.14% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 89.63% | 97.05% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.25% | 97.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.00% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.98% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.97% | 90.71% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 87.60% | 98.59% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 86.01% | 88.56% |
| CHEMBL1949 | P62937 | Cyclophilin A | 85.82% | 98.57% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 84.40% | 80.71% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.33% | 95.50% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 83.49% | 95.58% |
| CHEMBL1871 | P10275 | Androgen Receptor | 83.38% | 96.43% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.12% | 93.03% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.38% | 100.00% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 82.35% | 94.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.31% | 100.00% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 82.03% | 95.92% |
| CHEMBL2189110 | Q15910 | Histone-lysine N-methyltransferase EZH2 | 81.70% | 97.50% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.55% | 96.38% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 81.03% | 94.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 75995930 |
| LOTUS | LTS0179369 |
| wikiData | Q104198730 |