6-hydroxy-1,4a,6-trimethyl-5-(3-methylpenta-2,4-dienyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid
| Internal ID | ff801a20-6fe5-421d-98d3-4e052a420e68 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | 6-hydroxy-1,4a,6-trimethyl-5-(3-methylpenta-2,4-dienyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid |
| SMILES (Canonical) | CC(=CCC1C2(CCCC(C2CCC1(C)O)(C)C(=O)O)C)C=C |
| SMILES (Isomeric) | CC(=CCC1C2(CCCC(C2CCC1(C)O)(C)C(=O)O)C)C=C |
| InChI | InChI=1S/C20H32O3/c1-6-14(2)8-9-16-18(3)11-7-12-19(4,17(21)22)15(18)10-13-20(16,5)23/h6,8,15-16,23H,1,7,9-13H2,2-5H3,(H,21,22) |
| InChI Key | VYYQHKVFFRYRIH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.23514488 g/mol |
| Topological Polar Surface Area (TPSA) | 57.50 Ų |
| XlogP | 4.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.94% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.57% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.83% | 91.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.78% | 91.19% |
| CHEMBL233 | P35372 | Mu opioid receptor | 87.29% | 97.93% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.54% | 94.45% |
| CHEMBL4246 | P42680 | Tyrosine-protein kinase TEC | 84.11% | 82.05% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.40% | 96.38% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.39% | 95.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.13% | 100.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.80% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.19% | 93.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.27% | 91.07% |
| CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 80.26% | 97.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Chamaecyparis formosensis |
| PubChem | 162917820 |
| LOTUS | LTS0085479 |
| wikiData | Q105299562 |