1-[2,4-Dihydroxy-3-[3-[5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-2-enyl]-2-(4-hydroxyphenyl)-6-[2-(4-hydroxyphenyl)ethyl]oxan-4-yl]-6-methoxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one
Internal ID | a9622a39-a3ba-4788-8534-c943855034b9 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | 1-[2,4-dihydroxy-3-[3-[5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-2-enyl]-2-(4-hydroxyphenyl)-6-[2-(4-hydroxyphenyl)ethyl]oxan-4-yl]-6-methoxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
SMILES (Canonical) | COC1=C(C(=C(C(=C1)O)C2CC(OC(C2C(C=CCC(CCC3=CC=C(C=C3)O)O)C4=CC=C(C=C4)O)C5=CC=C(C=C5)O)CCC6=CC=C(C=C6)O)O)C(=O)C=CC7=CC=C(C=C7)O |
SMILES (Isomeric) | COC1=C(C(=C(C(=C1)O)C2CC(OC(C2C(C=CCC(CCC3=CC=C(C=C3)O)O)C4=CC=C(C=C4)O)C5=CC=C(C=C5)O)CCC6=CC=C(C=C6)O)O)C(=O)C=CC7=CC=C(C=C7)O |
InChI | InChI=1S/C54H54O11/c1-64-49-32-48(62)51(53(63)52(49)47(61)30-13-35-10-23-41(58)24-11-35)46-31-44(29-12-34-8-21-40(57)22-9-34)65-54(37-16-27-43(60)28-17-37)50(46)45(36-14-25-42(59)26-15-36)4-2-3-38(55)18-5-33-6-19-39(56)20-7-33/h2,4,6-11,13-17,19-28,30,32,38,44-46,50,54-60,62-63H,3,5,12,18,29,31H2,1H3 |
InChI Key | HIWNJCMWCICIHA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C54H54O11 |
Molecular Weight | 879.00 g/mol |
Exact Mass | 878.36661253 g/mol |
Topological Polar Surface Area (TPSA) | 197.00 Ų |
XlogP | 10.30 |
There are no found synonyms. |
![2D Structure of 1-[2,4-Dihydroxy-3-[3-[5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-2-enyl]-2-(4-hydroxyphenyl)-6-[2-(4-hydroxyphenyl)ethyl]oxan-4-yl]-6-methoxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one 2D Structure of 1-[2,4-Dihydroxy-3-[3-[5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-2-enyl]-2-(4-hydroxyphenyl)-6-[2-(4-hydroxyphenyl)ethyl]oxan-4-yl]-6-methoxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one](https://plantaedb.com/storage/docs/compounds/2023/11/92aba510-85f9-11ee-a6aa-6b8469391388.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.62% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.41% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 98.17% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.35% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.73% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.52% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 95.05% | 98.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 94.11% | 95.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.72% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.19% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.58% | 85.14% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.51% | 95.89% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.51% | 93.99% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.66% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.24% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 88.85% | 90.71% |
CHEMBL2535 | P11166 | Glucose transporter | 88.44% | 98.75% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 86.97% | 85.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.79% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.56% | 95.89% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 86.44% | 97.64% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 86.42% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.50% | 90.71% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.15% | 89.62% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.82% | 96.95% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.44% | 92.94% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 83.61% | 97.31% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.41% | 100.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.28% | 91.49% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.08% | 97.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.78% | 92.62% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.12% | 92.88% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.85% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alpinia roxburghii |
PubChem | 85084677 |
LOTUS | LTS0241226 |
wikiData | Q105029076 |