[(3R,3aS,6S,7S,8S,8aR)-7-[(E)-but-2-enoyl]-7-hydroxy-3,6-dimethyl-2-oxo-3a,4,5,6,8,8a-hexahydro-3H-cyclohepta[b]furan-8-yl] (Z)-2-methylbut-2-enoate
| Internal ID | e6c39750-fe8f-4715-b4ec-15141828b6b9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
| IUPAC Name | [(3R,3aS,6S,7S,8S,8aR)-7-[(E)-but-2-enoyl]-7-hydroxy-3,6-dimethyl-2-oxo-3a,4,5,6,8,8a-hexahydro-3H-cyclohepta[b]furan-8-yl] (Z)-2-methylbut-2-enoate |
| SMILES (Canonical) | CC=CC(=O)C1(C(CCC2C(C(=O)OC2C1OC(=O)C(=CC)C)C)C)O |
| SMILES (Isomeric) | C/C=C/C(=O)[C@@]1([C@H](CC[C@H]2[C@H](C(=O)O[C@H]2[C@@H]1OC(=O)/C(=C\C)/C)C)C)O |
| InChI | InChI=1S/C20H28O6/c1-6-8-15(21)20(24)12(4)9-10-14-13(5)19(23)25-16(14)17(20)26-18(22)11(3)7-2/h6-8,12-14,16-17,24H,9-10H2,1-5H3/b8-6+,11-7-/t12-,13+,14-,16+,17-,20+/m0/s1 |
| InChI Key | JJTAUBUHIJHGPA-XCGNFZCPSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.18858861 g/mol |
| Topological Polar Surface Area (TPSA) | 89.90 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
![2D Structure of [(3R,3aS,6S,7S,8S,8aR)-7-[(E)-but-2-enoyl]-7-hydroxy-3,6-dimethyl-2-oxo-3a,4,5,6,8,8a-hexahydro-3H-cyclohepta[b]furan-8-yl] (Z)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/929c6210-85a1-11ee-8ec3-a76c3ba70adb.jpg "2D Structure of [(3R,3aS,6S,7S,8S,8aR)-7-[(E)-but-2-enoyl]-7-hydroxy-3,6-dimethyl-2-oxo-3a,4,5,6,8,8a-hexahydro-3H-cyclohepta[b]furan-8-yl] (Z)-2-methylbut-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.11% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.82% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.34% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.99% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.93% | 89.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.48% | 92.94% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.09% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.41% | 91.19% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.29% | 97.25% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.09% | 99.23% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.69% | 97.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.62% | 100.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.56% | 91.07% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.35% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ratibida columnifera |
| PubChem | 163093092 |
| LOTUS | LTS0131625 |
| wikiData | Q105129888 |