3-[2-(2,4-dihydroxy-11,12-dimethyl-3,6-dioxatetracyclo[8.4.0.01,5.05,7]tetradecan-11-yl)ethyl]-2H-furan-5-one
| Internal ID | 6d2ebfa1-d1f1-45dc-8ad3-8f1a62d37d1d |
| Taxonomy | Organoheterocyclic compounds > Oxepanes |
| IUPAC Name | 3-[2-(2,4-dihydroxy-11,12-dimethyl-3,6-dioxatetracyclo[8.4.0.01,5.05,7]tetradecan-11-yl)ethyl]-2H-furan-5-one |
| SMILES (Canonical) | CC1CCC23C(C1(C)CCC4=CC(=O)OC4)CCC5C2(O5)C(OC3O)O |
| SMILES (Isomeric) | CC1CCC23C(C1(C)CCC4=CC(=O)OC4)CCC5C2(O5)C(OC3O)O |
| InChI | InChI=1S/C20H28O6/c1-11-5-8-19-13(18(11,2)7-6-12-9-15(21)24-10-12)3-4-14-20(19,26-14)17(23)25-16(19)22/h9,11,13-14,16-17,22-23H,3-8,10H2,1-2H3 |
| InChI Key | CYXRMZAZBZMBSL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.18858861 g/mol |
| Topological Polar Surface Area (TPSA) | 88.50 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.28% | 91.11% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.68% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.71% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.81% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.87% | 97.25% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.90% | 95.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.61% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.39% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.65% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.94% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.54% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.55% | 97.14% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 82.37% | 86.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.82% | 85.14% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.04% | 97.33% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.05% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gutierrezia texana |
| PubChem | 163049295 |
| LOTUS | LTS0070228 |
| wikiData | Q104972600 |