2-(2,4-dioxopyrimidin-1-yl)-3,7-dihydroxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-5-carboxylic acid
| Internal ID | e2095393-b100-4c06-8156-00ec4e31f63c |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Glycosylamines |
| IUPAC Name | 2-(2,4-dioxopyrimidin-1-yl)-3,7-dihydroxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-5-carboxylic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C12H14N2O8/c15-4-3-5(11(18)19)21-9-7(17)10(22-8(4)9)14-2-1-6(16)13-12(14)20/h1-2,4-5,7-10,15,17H,3H2,(H,18,19)(H,13,16,20) |
| InChI Key | DZLSLQGZUPNZTP-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C12H14N2O8 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.07501541 g/mol |
| Topological Polar Surface Area (TPSA) | 146.00 Ų |
| XlogP | -2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.85% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.95% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.72% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.25% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.75% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.21% | 89.00% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 86.15% | 94.45% |
| CHEMBL3137261 | O14744 | PRMT5/MEP50 complex | 85.66% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.30% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.07% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.77% | 95.56% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.56% | 83.82% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 81.14% | 95.48% |
| CHEMBL2123 | P51582 | Pyrimidinergic receptor P2Y4 | 81.07% | 93.39% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163044970 |
| LOTUS | LTS0214650 |
| wikiData | Q104991869 |