(3aR,4aR,5S,8R,8aS,9aR)-4a,8-dihydroxy-5,8a-dimethyl-3-methylidene-3a,4,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one
| Internal ID | d0bfeb9a-2408-47e4-9af1-00b0516e29b4 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Eudesmanolides, secoeudesmanolides, and derivatives |
| IUPAC Name | (3aR,4aR,5S,8R,8aS,9aR)-4a,8-dihydroxy-5,8a-dimethyl-3-methylidene-3a,4,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES (Canonical) | CC1CCC(C2(C1(CC3C(C2)OC(=O)C3=C)O)C)O |
| SMILES (Isomeric) | C[C@H]1CC[C@H]([C@]2([C@]1(C[C@H]3[C@@H](C2)OC(=O)C3=C)O)C)O |
| InChI | InChI=1S/C15H22O4/c1-8-4-5-12(16)14(3)7-11-10(6-15(8,14)18)9(2)13(17)19-11/h8,10-12,16,18H,2,4-7H2,1,3H3/t8-,10+,11+,12+,14-,15+/m0/s1 |
| InChI Key | VJHMBPAKWGACHZ-HZYUEDJHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.15180918 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
![2D Structure of (3aR,4aR,5S,8R,8aS,9aR)-4a,8-dihydroxy-5,8a-dimethyl-3-methylidene-3a,4,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/91edb7b0-8701-11ee-a5ff-8fc8451b4cec.jpg "2D Structure of (3aR,4aR,5S,8R,8aS,9aR)-4a,8-dihydroxy-5,8a-dimethyl-3-methylidene-3a,4,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.67% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.71% | 85.14% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.87% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.15% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.75% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.59% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.44% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.28% | 99.23% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.13% | 93.03% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.03% | 96.09% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.70% | 97.05% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.58% | 92.94% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.48% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.79% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.77% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Inula japonica |
| PubChem | 50917737 |
| LOTUS | LTS0152922 |
| wikiData | Q105287260 |