methyl (1R,4aR,7S,7aR)-5'-oxo-1-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4'-[(1R)-1-[(E)-3-[4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxyethyl]spiro[4a,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-furan]-4-carboxylate
Internal ID | e90d05da-12ac-465c-8566-dbafc1e4e983 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl (1R,4aR,7S,7aR)-5'-oxo-1-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4'-[(1R)-1-[(E)-3-[4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxyethyl]spiro[4a,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-furan]-4-carboxylate |
SMILES (Canonical) | CC(C1=CC2(C=CC3C2C(OC=C3C(=O)OC)OC4C(C(C(C(O4)CO)O)O)O)OC1=O)OC(=O)C=CC5=CC=C(C=C5)OC6C(C(C(C(O6)CO)O)O)O |
SMILES (Isomeric) | C[C@H](C1=C[C@]2(C=C[C@@H]3[C@H]2[C@H](OC=C3C(=O)OC)O[C@@H]4[C@H]([C@@H]([C@H]([C@@H](O4)CO)O)O)O)OC1=O)OC(=O)/C=C/C5=CC=C(C=C5)O[C@@H]6[C@H]([C@@H]([C@H]([C@@H](O6)CO)O)O)O |
InChI | InChI=1S/C36H42O19/c1-15(50-23(39)8-5-16-3-6-17(7-4-16)51-34-29(44)27(42)25(40)21(12-37)52-34)19-11-36(55-32(19)47)10-9-18-20(31(46)48-2)14-49-33(24(18)36)54-35-30(45)28(43)26(41)22(13-38)53-35/h3-11,14-15,18,21-22,24-30,33-35,37-38,40-45H,12-13H2,1-2H3/b8-5+/t15-,18+,21+,22+,24+,25+,26+,27-,28-,29+,30+,33-,34+,35-,36+/m1/s1 |
InChI Key | AFYIWKNGSIYXCQ-KAYJCYQMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H42O19 |
Molecular Weight | 778.70 g/mol |
Exact Mass | 778.23202911 g/mol |
Topological Polar Surface Area (TPSA) | 287.00 Ų |
XlogP | -1.30 |
80396-57-2 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.01% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.23% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.63% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.22% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.05% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.93% | 90.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.78% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.29% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.12% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.05% | 95.56% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 90.13% | 91.07% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.69% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.10% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.69% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.39% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.35% | 85.14% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 86.03% | 89.67% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.09% | 92.88% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.22% | 94.45% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.19% | 95.83% |
CHEMBL5028 | O14672 | ADAM10 | 81.23% | 97.50% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.23% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allamanda schottii |
Plumeria rubra |
PubChem | 133561887 |
LOTUS | LTS0169112 |
wikiData | Q104911634 |