9,10-Dihydro-5,6,8-trimethoxy-3,4-phenanthrenediol
| Internal ID | fcfc7802-bcc9-41a1-8a42-716661ac95f8 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 5,6,8-trimethoxy-9,10-dihydrophenanthrene-3,4-diol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H18O5/c1-20-12-8-13(21-2)17(22-3)15-10(12)6-4-9-5-7-11(18)16(19)14(9)15/h5,7-8,18-19H,4,6H2,1-3H3 |
| InChI Key | YKNPNQJMTYXYGI-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.11542367 g/mol |
| Topological Polar Surface Area (TPSA) | 68.20 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.03% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.66% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.57% | 96.09% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 93.44% | 91.79% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.96% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.48% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.61% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.61% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.18% | 86.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.84% | 93.99% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 86.88% | 95.70% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.93% | 98.75% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 85.20% | 91.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.85% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.78% | 99.17% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.58% | 89.62% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.58% | 92.68% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.00% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.50% | 95.89% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 80.31% | 89.32% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 80.26% | 98.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dioscorea prazeri |
| PubChem | 129856043 |
| LOTUS | LTS0074302 |
| wikiData | Q105349788 |