9,10-Dihydro-2,3,5,7-Phenanthrenetetrol
| Internal ID | 21024032-1ef4-4496-88da-2c606ef8e5a3 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 9,10-dihydrophenanthrene-2,3,5,7-tetrol |
| SMILES (Canonical) | C1CC2=C(C3=CC(=C(C=C31)O)O)C(=CC(=C2)O)O |
| SMILES (Isomeric) | C1CC2=C(C3=CC(=C(C=C31)O)O)C(=CC(=C2)O)O |
| InChI | InChI=1S/C14H12O4/c15-9-3-8-2-1-7-4-11(16)12(17)6-10(7)14(8)13(18)5-9/h3-6,15-18H,1-2H2 |
| InChI Key | NIGUICNPKCJLJQ-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.07355886 g/mol |
| Topological Polar Surface Area (TPSA) | 80.90 Ų |
| XlogP | 2.40 |
| 9,10-dihydrophenanthrene-2,3,5,7-tetrol |
| SCHEMBL11505126 |
| CHEBI:174259 |
| DTXSID001279866 |
| 2,3,5,7-Tetrahydroxy-9,10-dihydrophenanthrene |
| 2,4,6,7-tetrahydroxy-9,10-dihydrophenanthrene |
| 2,4,6,7-Tetrahydroxy-9-10-dihydrophenanthrene |
| 22318-82-7 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.42% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.27% | 91.49% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 91.94% | 96.12% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.31% | 90.00% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 87.86% | 98.35% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.59% | 93.40% |
| CHEMBL5145 | P15056 | Serine/threonine-protein kinase B-raf | 86.27% | 97.90% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 86.13% | 91.79% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.85% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.20% | 96.09% |
| CHEMBL3194 | P02766 | Transthyretin | 82.69% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.44% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.66% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dioscorea bulbifera |
| Senna garrettiana |
| PubChem | 22753774 |
| LOTUS | LTS0139692 |
| wikiData | Q105179805 |