9,10-Anthracenedione, 1,3-dihydroxy-4-methoxy-2-methyl-
| Internal ID | ef5933c0-3a2f-41a5-80e6-cc5b209886f9 |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones > Hydroxyanthraquinones |
| IUPAC Name | 1,3-dihydroxy-4-methoxy-2-methylanthracene-9,10-dione |
| SMILES (Canonical) | CC1=C(C2=C(C(=C1O)OC)C(=O)C3=CC=CC=C3C2=O)O |
| SMILES (Isomeric) | CC1=C(C2=C(C(=C1O)OC)C(=O)C3=CC=CC=C3C2=O)O |
| InChI | InChI=1S/C16H12O5/c1-7-12(17)10-11(16(21-2)13(7)18)15(20)9-6-4-3-5-8(9)14(10)19/h3-6,17-18H,1-2H3 |
| InChI Key | SYBVTSFWLPOQKR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 83.80 Ų |
| XlogP | 3.00 |
| SYBVTSFWLPOQKR-UHFFFAOYSA-N |
| 1,3-Dihydroxy-4-methoxy-2-methylanthra-9,10-quinone # |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.10% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.44% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.71% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.29% | 91.49% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.46% | 99.23% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 86.39% | 96.67% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.37% | 98.75% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.32% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.20% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.61% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.30% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.14% | 94.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.02% | 96.00% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 80.35% | 98.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Digitalis lanata |
| Digitalis purpurea |
| PubChem | 625092 |
| LOTUS | LTS0047160 |
| wikiData | Q105263470 |