(7E,9S,10S,11S,12E,14S,16E,20S,21S,22E)-31-amino-4,10,14,20-tetrahydroxy-3,7,9,11,17,21,27-heptamethyl-29-azatricyclo[28.3.1.05,33]tetratriaconta-1(33),2,4,7,12,16,22,24,26,30-decaene-6,18,28,32,34-pentone
| Internal ID | 0058f506-ea56-4170-91f8-8e25c66699bf |
| Taxonomy | Benzenoids > Naphthalenes > Naphthoquinones |
| IUPAC Name | (7E,9S,10S,11S,12E,14S,16E,20S,21S,22E)-31-amino-4,10,14,20-tetrahydroxy-3,7,9,11,17,21,27-heptamethyl-29-azatricyclo[28.3.1.05,33]tetratriaconta-1(33),2,4,7,12,16,22,24,26,30-decaene-6,18,28,32,34-pentone |
| SMILES (Canonical) | CC1C=CC=CC=C(C(=O)NC2=C(C(=O)C3=C(C2=O)C=C(C(=C3C(=O)C(=CC(C(C(C=CC(CC=C(C(=O)CC1O)C)O)C)O)C)C)O)C)N)C |
| SMILES (Isomeric) | C[C@H]1/C=C/C=CC=C(C(=O)NC2=C(C(=O)C3=C(C2=O)C=C(C(=C3C(=O)/C(=C/[C@@H]([C@H]([C@H](/C=C/[C@H](C/C=C(/C(=O)C[C@@H]1O)\C)O)C)O)C)/C)O)C)N)C |
| InChI | InChI=1S/C40H48N2O9/c1-20-11-9-8-10-12-23(4)40(51)42-34-33(41)39(50)31-28(38(34)49)18-26(7)37(48)32(31)36(47)25(6)17-24(5)35(46)22(3)14-16-27(43)15-13-21(2)30(45)19-29(20)44/h8-14,16-18,20,22,24,27,29,35,43-44,46,48H,15,19,41H2,1-7H3,(H,42,51)/b10-8?,11-9+,16-14+,21-13+,23-12?,25-17+/t20-,22-,24-,27-,29-,35-/m0/s1 |
| InChI Key | JUWFHSXVGJIUPA-CYMXOAMJSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C40H48N2O9 |
| Molecular Weight | 700.80 g/mol |
| Exact Mass | 700.33598111 g/mol |
| Topological Polar Surface Area (TPSA) | 204.00 Ų |
| XlogP | 4.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.07% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.60% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.94% | 98.95% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 95.14% | 96.21% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.66% | 94.75% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.56% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.82% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.80% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.35% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.34% | 100.00% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 89.15% | 95.52% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.63% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.48% | 99.23% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.22% | 93.03% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.56% | 99.15% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.25% | 92.94% |
| CHEMBL5145 | P15056 | Serine/threonine-protein kinase B-raf | 86.08% | 97.90% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.99% | 94.00% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 82.66% | 96.00% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 81.30% | 86.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.29% | 93.18% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.95% | 93.04% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 80.82% | 95.62% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.37% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163189116 |
| LOTUS | LTS0108125 |
| wikiData | Q105135457 |