[(3R,3aS,6S,7S,8S,8aR)-7-hydroxy-7-[(3S)-3-hydroxybutanoyl]-3,6-dimethyl-2-oxo-3a,4,5,6,8,8a-hexahydro-3H-cyclohepta[b]furan-8-yl] (Z)-2-methylbut-2-enoate
Internal ID | 8dacad5e-f629-4bf5-8da0-047f4bad703c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | [(3R,3aS,6S,7S,8S,8aR)-7-hydroxy-7-[(3S)-3-hydroxybutanoyl]-3,6-dimethyl-2-oxo-3a,4,5,6,8,8a-hexahydro-3H-cyclohepta[b]furan-8-yl] (Z)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C2C(CCC(C1(C(=O)CC(C)O)O)C)C(C(=O)O2)C |
SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@H]1[C@H]2[C@@H](CC[C@@H]([C@]1(C(=O)C[C@H](C)O)O)C)[C@H](C(=O)O2)C |
InChI | InChI=1S/C20H30O7/c1-6-10(2)18(23)27-17-16-14(13(5)19(24)26-16)8-7-11(3)20(17,25)15(22)9-12(4)21/h6,11-14,16-17,21,25H,7-9H2,1-5H3/b10-6-/t11-,12-,13+,14-,16+,17-,20+/m0/s1 |
InChI Key | BBAISYCWVQINOR-QKKQDRQLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H30O7 |
Molecular Weight | 382.40 g/mol |
Exact Mass | 382.19915329 g/mol |
Topological Polar Surface Area (TPSA) | 110.00 Ų |
XlogP | 1.80 |
There are no found synonyms. |
![2D Structure of [(3R,3aS,6S,7S,8S,8aR)-7-hydroxy-7-[(3S)-3-hydroxybutanoyl]-3,6-dimethyl-2-oxo-3a,4,5,6,8,8a-hexahydro-3H-cyclohepta[b]furan-8-yl] (Z)-2-methylbut-2-enoate 2D Structure of [(3R,3aS,6S,7S,8S,8aR)-7-hydroxy-7-[(3S)-3-hydroxybutanoyl]-3,6-dimethyl-2-oxo-3a,4,5,6,8,8a-hexahydro-3H-cyclohepta[b]furan-8-yl] (Z)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/9059dec0-860b-11ee-bc24-7d1412616be9.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.03% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.52% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.27% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.82% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.42% | 94.45% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.32% | 96.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.98% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.69% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.68% | 95.56% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.25% | 90.08% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.77% | 91.19% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 84.47% | 82.50% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.42% | 97.21% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.06% | 91.07% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.82% | 97.14% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.62% | 83.82% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.30% | 99.17% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.68% | 89.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.41% | 99.23% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.31% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ratibida columnifera |
PubChem | 163041062 |
LOTUS | LTS0134221 |
wikiData | Q104922594 |