(3,4,5-trihydroxyoxan-2-yl) 4,7,8-trimethyl-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-1,2,5,6,7,8a-hexahydronaphthalene-4a-carboxylate
| Internal ID | 3b23edf1-b491-4263-8f36-b0ac83ffa38b |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
| IUPAC Name | (3,4,5-trihydroxyoxan-2-yl) 4,7,8-trimethyl-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-1,2,5,6,7,8a-hexahydronaphthalene-4a-carboxylate |
| SMILES (Canonical) | CC1CCC2(C(C1(C)CCC3=CC(=O)OC3)CCC=C2C)C(=O)OC4C(C(C(CO4)O)O)O |
| SMILES (Isomeric) | CC1CCC2(C(C1(C)CCC3=CC(=O)OC3)CCC=C2C)C(=O)OC4C(C(C(CO4)O)O)O |
| InChI | InChI=1S/C25H36O8/c1-14-7-10-25(23(30)33-22-21(29)20(28)17(26)13-32-22)15(2)5-4-6-18(25)24(14,3)9-8-16-11-19(27)31-12-16/h5,11,14,17-18,20-22,26,28-29H,4,6-10,12-13H2,1-3H3 |
| InChI Key | HXIWGPICAFPUEN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H36O8 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.24101810 g/mol |
| Topological Polar Surface Area (TPSA) | 123.00 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
![2D Structure of (3,4,5-trihydroxyoxan-2-yl) 4,7,8-trimethyl-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-1,2,5,6,7,8a-hexahydronaphthalene-4a-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/9021e410-8799-11ee-b160-51875f5fa019.jpg "2D Structure of (3,4,5-trihydroxyoxan-2-yl) 4,7,8-trimethyl-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-1,2,5,6,7,8a-hexahydronaphthalene-4a-carboxylate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.70% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.04% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.28% | 83.82% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.08% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.32% | 98.95% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.93% | 96.61% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.32% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.16% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.83% | 95.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.23% | 96.47% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.32% | 96.77% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.81% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.25% | 89.00% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 85.96% | 83.57% |
| CHEMBL5028 | O14672 | ADAM10 | 84.32% | 97.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.18% | 99.23% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.35% | 97.33% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.46% | 95.93% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 82.17% | 86.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.81% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gutierrezia texana |
| PubChem | 162876688 |
| LOTUS | LTS0091194 |
| wikiData | Q105035029 |