[(1S)-1-[4-[(2S,3S,8S,9S,10R,17S,18S)-18-hydroxy-8-methoxy-3,7,9,13,15,17,20,23-octamethyl-24-oxo-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-oxacyclotetracosa-4,6,11,13,15,19,22-heptaen-2-yl]-1,3-thiazol-2-yl]-3-methylbutyl] N-methylcarbamate
| Internal ID | 1dc1d8c5-b1c2-4e32-8729-a83858b9efd2 |
| Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
| IUPAC Name | [(1S)-1-[4-[(2S,3S,8S,9S,10R,17S,18S)-18-hydroxy-8-methoxy-3,7,9,13,15,17,20,23-octamethyl-24-oxo-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-oxacyclotetracosa-4,6,11,13,15,19,22-heptaen-2-yl]-1,3-thiazol-2-yl]-3-methylbutyl] N-methylcarbamate |
| SMILES (Canonical) | CC1C=CC=C(C(C(C(C=CC(=CC(=CC(C(C=C(CC=C(C(=O)OC1C2=CSC(=N2)C(CC(C)C)OC(=O)NC)C)C)O)C)C)C)OC3C(C(C(C(O3)CO)O)O)O)C)OC)C |
| SMILES (Isomeric) | C[C@H]1C=CC=C([C@H]([C@H]([C@@H](C=CC(=CC(=C[C@@H]([C@@H](C=C(CC=C(C(=O)O[C@@H]1C2=CSC(=N2)[C@H](CC(C)C)OC(=O)NC)C)C)O)C)C)C)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C)OC)C |
| InChI | InChI=1S/C48H72N2O12S/c1-26(2)20-38(61-48(57)49-11)45-50-35(25-63-45)44-31(7)15-13-14-30(6)43(58-12)34(10)37(59-47-42(55)41(54)40(53)39(24-51)60-47)19-17-27(3)21-29(5)22-33(9)36(52)23-28(4)16-18-32(8)46(56)62-44/h13-15,17-19,21-23,25-26,31,33-34,36-44,47,51-55H,16,20,24H2,1-12H3,(H,49,57)/t31-,33-,34-,36+,37+,38-,39+,40+,41-,42+,43+,44-,47+/m0/s1 |
| InChI Key | JOMXBNJRLRZHRP-FHBZPYIYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C48H72N2O12S |
| Molecular Weight | 901.20 g/mol |
| Exact Mass | 900.48059691 g/mol |
| Topological Polar Surface Area (TPSA) | 235.00 Ų |
| XlogP | 5.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.38% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.51% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.32% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.36% | 96.09% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 95.96% | 97.53% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 95.33% | 99.23% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.11% | 83.82% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 93.47% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.71% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.08% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.65% | 94.73% |
| CHEMBL5028 | O14672 | ADAM10 | 89.27% | 97.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.86% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.33% | 93.56% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 88.11% | 92.29% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 88.04% | 97.33% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 85.89% | 95.71% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.52% | 96.90% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 84.98% | 98.05% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.06% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.49% | 94.00% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.50% | 97.36% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.25% | 96.95% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.06% | 96.47% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 80.98% | 85.94% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.48% | 99.17% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.15% | 97.14% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.06% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139586372 |
| LOTUS | LTS0088438 |
| wikiData | Q77505172 |