9-Methyl-14-methylidene-6-oxotetracyclo[11.2.1.01,10.04,9]hexadeca-2,4-diene-5-carbaldehyde
| Internal ID | 5df0d94a-ff03-4769-bdac-e85f66696ada |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
| IUPAC Name | 9-methyl-14-methylidene-6-oxotetracyclo[11.2.1.01,10.04,9]hexadeca-2,4-diene-5-carbaldehyde |
| SMILES (Canonical) | CC12CCC(=O)C(=C1C=CC34C2CCC(C3)C(=C)C4)C=O |
| SMILES (Isomeric) | CC12CCC(=O)C(=C1C=CC34C2CCC(C3)C(=C)C4)C=O |
| InChI | InChI=1S/C19H22O2/c1-12-9-19-8-5-15-14(11-20)16(21)6-7-18(15,2)17(19)4-3-13(12)10-19/h5,8,11,13,17H,1,3-4,6-7,9-10H2,2H3 |
| InChI Key | UBOLFKFUWUMQQO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.161979940 g/mol |
| Topological Polar Surface Area (TPSA) | 34.10 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
![2D Structure of 9-Methyl-14-methylidene-6-oxotetracyclo[11.2.1.01,10.04,9]hexadeca-2,4-diene-5-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/9-methyl-14-methylidene-6-oxotetracyclo11210110049hexadeca-24-diene-5-carbaldehyde.jpg "2D Structure of 9-Methyl-14-methylidene-6-oxotetracyclo[11.2.1.01,10.04,9]hexadeca-2,4-diene-5-carbaldehyde")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.31% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.66% | 95.56% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.10% | 93.40% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.10% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.08% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.06% | 91.11% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.92% | 96.38% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.86% | 95.38% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.51% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.06% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.56% | 94.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.82% | 97.09% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.93% | 93.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.68% | 96.77% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.85% | 95.89% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 80.92% | 97.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Athrixia arachnoidea |
| Athrixia elata |
| PubChem | 162845220 |
| LOTUS | LTS0161337 |
| wikiData | Q105269538 |