9-Methoxy-pentadecanoic acid
| Internal ID | d2c4928e-ddf9-428e-ae67-180baf4a3a55 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Long-chain fatty acids |
| IUPAC Name | 9-methoxypentadecanoic acid |
| SMILES (Canonical) | CCCCCCC(CCCCCCCC(=O)O)OC |
| SMILES (Isomeric) | CCCCCCC(CCCCCCCC(=O)O)OC |
| InChI | InChI=1S/C16H32O3/c1-3-4-5-9-12-15(19-2)13-10-7-6-8-11-14-16(17)18/h15H,3-14H2,1-2H3,(H,17,18) |
| InChI Key | QWMAMXJYEIAKRF-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.23514488 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 5.20 |
| 9-methoxypentadecanoic acid |
| CHEBI:184524 |
| LMFA01080013 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.43% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.66% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.95% | 98.95% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.75% | 92.08% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.54% | 95.17% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.12% | 97.29% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 86.94% | 93.31% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.49% | 93.56% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 86.28% | 85.94% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.21% | 92.50% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 85.87% | 97.00% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 84.70% | 89.63% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 84.65% | 96.00% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.45% | 91.81% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 84.26% | 92.26% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.61% | 91.19% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.95% | 96.95% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 81.14% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.00% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 15389269 |
| LOTUS | LTS0077947 |
| wikiData | Q105229268 |