9-methoxy-6H-[1]benzofuro[3,2-c]chromene-3,4,7-triol
| Internal ID | e95c7b94-481e-4dd3-80a0-1ce9ae1d8dbd |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Furanoisoflavonoids > Pterocarpans |
| IUPAC Name | 9-methoxy-6H-[1]benzofuro[3,2-c]chromene-3,4,7-triol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H12O6/c1-20-7-4-11(18)13-9-6-21-16-8(2-3-10(17)14(16)19)15(9)22-12(13)5-7/h2-5,17-19H,6H2,1H3 |
| InChI Key | DFYNCWHKXQJWGT-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 92.30 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
![2D Structure of 9-methoxy-6H-[1]benzofuro[3,2-c]chromene-3,4,7-triol](https://plantaedb.com/storage/docs/compounds/2023/11/9-methoxy-6h-1benzofuro32-cchromene-347-triol.jpg "2D Structure of 9-methoxy-6H-[1]benzofuro[3,2-c]chromene-3,4,7-triol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.50% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.79% | 91.49% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.92% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.73% | 94.00% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 92.68% | 98.35% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.96% | 90.00% |
| CHEMBL3194 | P02766 | Transthyretin | 90.68% | 90.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.74% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.03% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.73% | 89.00% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 85.73% | 88.48% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.69% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.62% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.18% | 96.09% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.08% | 90.24% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.75% | 93.31% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.49% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.92% | 94.45% |
| CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 81.81% | 95.55% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.45% | 97.09% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.21% | 93.65% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.87% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.28% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 50908263 |
| LOTUS | LTS0211434 |
| wikiData | Q104978452 |