9-Hydroxylinoleic acid
Internal ID | 8aeb0c8c-4a9d-472f-b8ea-024cc7153b29 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Lineolic acids and derivatives |
IUPAC Name | (9E,12Z)-9-hydroxyoctadeca-9,12-dienoic acid |
SMILES (Canonical) | CCCCCC=CCC=C(CCCCCCCC(=O)O)O |
SMILES (Isomeric) | CCCCC/C=C\C/C=C(\CCCCCCCC(=O)O)/O |
InChI | InChI=1S/C18H32O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,14,19H,2-5,7,9-13,15-16H2,1H3,(H,20,21)/b8-6-,17-14+ |
InChI Key | JDOLBVXUTAGQDQ-LZOINSICSA-N |
Popularity | 136 references in papers |
Molecular Formula | C18H32O3 |
Molecular Weight | 296.40 g/mol |
Exact Mass | 296.23514488 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 5.80 |
SCHEMBL5375405 |
(9E,12Z)-9-hydroxyoctadeca-9,12-dienoic acid |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.13% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 95.97% | 98.95% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 95.31% | 89.63% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.93% | 92.08% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.45% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.64% | 96.09% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 91.15% | 97.00% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 84.47% | 85.94% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.39% | 96.95% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.12% | 93.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.35% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Begonia nantoensis |
Oryza sativa |
PubChem | 21158590 |
LOTUS | LTS0171285 |
wikiData | Q104391532 |