9-(Furan-3-yl)-2,6-dimethylnon-6-en-4-one
Internal ID | 6da3fc8c-0edc-4a57-98e6-cd9ff1b2e8d2 |
Taxonomy | Organoheterocyclic compounds > Heteroaromatic compounds |
IUPAC Name | 9-(furan-3-yl)-2,6-dimethylnon-6-en-4-one |
SMILES (Canonical) | CC(C)CC(=O)CC(=CCCC1=COC=C1)C |
SMILES (Isomeric) | CC(C)CC(=O)CC(=CCCC1=COC=C1)C |
InChI | InChI=1S/C15H22O2/c1-12(2)9-15(16)10-13(3)5-4-6-14-7-8-17-11-14/h5,7-8,11-12H,4,6,9-10H2,1-3H3 |
InChI Key | ILWBIDIEAHLKTC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H22O2 |
Molecular Weight | 234.33 g/mol |
Exact Mass | 234.161979940 g/mol |
Topological Polar Surface Area (TPSA) | 30.20 Ų |
XlogP | 3.70 |
68776-27-2 |
DTXSID40790438 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.22% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.62% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.11% | 94.73% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.47% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.66% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.25% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.75% | 96.09% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 84.81% | 83.10% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.53% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.39% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.29% | 89.00% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.03% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ursinia nana |
Ursinia serrata |
Ursinia speciosa |
PubChem | 71367312 |
LOTUS | LTS0042110 |
wikiData | Q82758227 |