9-Chloro-10-hydroxyhexadecanoic acid
| Internal ID | 085c685a-6b57-4650-9a47-c28295af61e7 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Long-chain fatty acids |
| IUPAC Name | 9-chloro-10-hydroxyhexadecanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H31ClO3/c1-2-3-4-9-12-15(18)14(17)11-8-6-5-7-10-13-16(19)20/h14-15,18H,2-13H2,1H3,(H,19,20) |
| InChI Key | YTOQELMVXKVDDX-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H31ClO3 |
| Molecular Weight | 306.90 g/mol |
| Exact Mass | 306.1961725 g/mol |
| Topological Polar Surface Area (TPSA) | 57.50 Ų |
| XlogP | 5.30 |
| 9-chloro-10-hydroxy-hexadecanoic acid |
| 9-Chloro-10-hydroxypalmitic acid |
| 9-Chloro-10-hydroxypalmitate |
| CHEBI:34508 |
| LMFA01090044 |
| Q27116119 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 97.42% | 85.94% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.53% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.45% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.75% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.70% | 90.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.50% | 83.82% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.39% | 97.29% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.41% | 89.63% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.23% | 92.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.83% | 93.56% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 87.69% | 92.26% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.58% | 100.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.46% | 100.00% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 84.04% | 92.29% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.30% | 92.86% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.05% | 93.31% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 82.93% | 96.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.47% | 92.50% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.48% | 95.17% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 81.34% | 97.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 656826 |
| LOTUS | LTS0079447 |
| wikiData | Q27116119 |