9-(4-Methoxyphenyl)phenalen-1-one
| Internal ID | 1192d32a-4866-47f7-ae7a-36c6845e0823 |
| Taxonomy | Benzenoids > Naphthalenes > Phenylnaphthalenes |
| IUPAC Name | 9-(4-methoxyphenyl)phenalen-1-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)C2=C3C(=O)C=CC4=CC=CC(=C43)C=C2 |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C2=C3C(=O)C=CC4=CC=CC(=C43)C=C2 |
| InChI | InChI=1S/C20H14O2/c1-22-16-9-5-13(6-10-16)17-11-7-14-3-2-4-15-8-12-18(21)20(17)19(14)15/h2-12H,1H3 |
| InChI Key | ZGRXGTCQXRGSEI-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C20H14O2 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.099379685 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 4.80 |
| 65874-43-3 |
| CHEMBL227445 |
| DTXSID40373043 |
| AKOS004902238 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1907 | P15144 | Aminopeptidase N | 98.40% | 93.31% |
| CHEMBL240 | Q12809 | HERG | 96.62% | 89.76% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.55% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.89% | 95.56% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 94.44% | 96.67% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.31% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.10% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.26% | 91.11% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.07% | 86.92% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.10% | 91.49% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 87.05% | 92.67% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 86.09% | 87.67% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.00% | 99.15% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.93% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.11% | 98.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.06% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.15% | 99.23% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 82.04% | 96.09% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.67% | 95.50% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 80.44% | 89.63% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Musa acuminata |
| PubChem | 2754648 |
| LOTUS | LTS0111193 |
| wikiData | Q82161152 |