9-(3,7-dimethylocta-2,6-dienyl)-3-methyl-7H-purine-2,6,8-trione
| Internal ID | aa9bd5b6-5a37-4ba5-ae2a-af17c3338b88 |
| Taxonomy | Organoheterocyclic compounds > Imidazopyrimidines > Purines and purine derivatives > Xanthines |
| IUPAC Name | 9-(3,7-dimethylocta-2,6-dienyl)-3-methyl-7H-purine-2,6,8-trione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H22N4O3/c1-10(2)6-5-7-11(3)8-9-20-14-12(17-16(20)23)13(21)18-15(22)19(14)4/h6,8H,5,7,9H2,1-4H3,(H,17,23)(H,18,21,22) |
| InChI Key | BTFUWYCAQYPMPS-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16919058 g/mol |
| Topological Polar Surface Area (TPSA) | 81.80 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL255 | P29275 | Adenosine A2b receptor | 98.50% | 98.59% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.54% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.74% | 98.95% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.95% | 92.08% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.46% | 86.92% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.92% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.80% | 95.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.18% | 90.08% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.59% | 89.34% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.11% | 94.73% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.31% | 97.25% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.87% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163012382 |
| LOTUS | LTS0225433 |
| wikiData | Q103816996 |