9-[3-Hydroxy-6-(2-hydroxyethylidene)-2-methyloxepan-2-yl]-2,3,6-trimethylnon-1-en-5-one
Internal ID | 75686be1-8b22-4705-b3d2-551745b93241 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 9-[3-hydroxy-6-(2-hydroxyethylidene)-2-methyloxepan-2-yl]-2,3,6-trimethylnon-1-en-5-one |
SMILES (Canonical) | CC(CCCC1(C(CCC(=CCO)CO1)O)C)C(=O)CC(C)C(=C)C |
SMILES (Isomeric) | CC(CCCC1(C(CCC(=CCO)CO1)O)C)C(=O)CC(C)C(=C)C |
InChI | InChI=1S/C21H36O4/c1-15(2)17(4)13-19(23)16(3)7-6-11-21(5)20(24)9-8-18(10-12-22)14-25-21/h10,16-17,20,22,24H,1,6-9,11-14H2,2-5H3 |
InChI Key | RGZQWWIRERFFQN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H36O4 |
Molecular Weight | 352.50 g/mol |
Exact Mass | 352.26135963 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 2.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.69% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.73% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.35% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.78% | 98.95% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.80% | 93.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.30% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.62% | 91.19% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.21% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.94% | 96.47% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.06% | 89.00% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 85.20% | 94.66% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.99% | 91.24% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.21% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.39% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.18% | 97.09% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.08% | 100.00% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.21% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Montanoa tomentosa |
PubChem | 162860755 |
LOTUS | LTS0104503 |
wikiData | Q105236177 |