9-[3-[5-Hydroxy-3-(hydroxymethyl)pent-3-enyl]-2-methyloxiran-2-yl]-2,6-dimethylnon-2-en-5-one
Internal ID | e62b173a-d85f-4e88-b56a-82a31a4ccdcb |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 9-[3-[5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-2-methyloxiran-2-yl]-2,6-dimethylnon-2-en-5-one |
SMILES (Canonical) | CC(CCCC1(C(O1)CCC(=CCO)CO)C)C(=O)CC=C(C)C |
SMILES (Isomeric) | CC(CCCC1(C(O1)CCC(=CCO)CO)C)C(=O)CC=C(C)C |
InChI | InChI=1S/C20H34O4/c1-15(2)7-9-18(23)16(3)6-5-12-20(4)19(24-20)10-8-17(14-22)11-13-21/h7,11,16,19,21-22H,5-6,8-10,12-14H2,1-4H3 |
InChI Key | HAEAVKBVZVAUFR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H34O4 |
Molecular Weight | 338.50 g/mol |
Exact Mass | 338.24570956 g/mol |
Topological Polar Surface Area (TPSA) | 70.10 Ų |
XlogP | 2.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.65% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.93% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.32% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.38% | 96.61% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.39% | 96.47% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.16% | 93.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.88% | 99.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.67% | 91.19% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.37% | 91.24% |
CHEMBL2581 | P07339 | Cathepsin D | 87.29% | 98.95% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 84.56% | 98.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.32% | 90.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.92% | 94.73% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.04% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.76% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.68% | 97.09% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.59% | 97.29% |
CHEMBL1801 | P00747 | Plasminogen | 81.96% | 92.44% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.15% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.13% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.03% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Montanoa tomentosa |
PubChem | 163048962 |
LOTUS | LTS0137262 |
wikiData | Q105024821 |