9-[[(2R)-2-Hydroxy-3-methyl-3-buten-1-yl]oxy]-7H-furo[3,2-g][1]benzopyran-7-one; (+)-Isogospherol
Internal ID | 8759a6a4-8732-4115-abf4-99245883e9fb |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Furanocoumarins > Psoralens |
IUPAC Name | 9-[(2S)-2-hydroxy-3-methylbut-3-enoxy]furo[3,2-g]chromen-7-one |
SMILES (Canonical) | CC(=C)C(COC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2)O |
SMILES (Isomeric) | CC(=C)[C@@H](COC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2)O |
InChI | InChI=1S/C16H14O5/c1-9(2)12(17)8-20-16-14-11(5-6-19-14)7-10-3-4-13(18)21-15(10)16/h3-7,12,17H,1,8H2,2H3/t12-/m1/s1 |
InChI Key | RTUPRHIHXSAWDP-GFCCVEGCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H14O5 |
Molecular Weight | 286.28 g/mol |
Exact Mass | 286.08412354 g/mol |
Topological Polar Surface Area (TPSA) | 68.90 Ų |
XlogP | 2.50 |
FS-9983 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.31% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.57% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.22% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.22% | 94.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.28% | 97.21% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.18% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.55% | 99.17% |
CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 84.75% | 92.29% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.62% | 96.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.61% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.20% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.72% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.43% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.72% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.16% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Metrodorea nigra |
Prangos pabularia |
Rhadinothamnus rudis |
PubChem | 91895301 |
LOTUS | LTS0206154 |
wikiData | Q105245419 |