9-(2,4-Dibromo-5-methoxyphenyl)-8-hydroxy-7-methyl-1,7-diazaspiro[4.4]non-1-en-6-one
| Internal ID | 9aceaf4a-0e15-4ba3-b8ae-dbb681062f9a |
| Taxonomy | Organoheterocyclic compounds > Pyrrolidines > Phenylpyrrolidines |
| IUPAC Name | 9-(2,4-dibromo-5-methoxyphenyl)-8-hydroxy-7-methyl-1,7-diazaspiro[4.4]non-1-en-6-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H16Br2N2O3/c1-19-13(20)12(15(14(19)21)4-3-5-18-15)8-6-11(22-2)10(17)7-9(8)16/h5-7,12-13,20H,3-4H2,1-2H3 |
| InChI Key | BYQNGGZSSNMKGE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H16Br2N2O3 |
| Molecular Weight | 432.11 g/mol |
| Exact Mass | 431.95072 g/mol |
| Topological Polar Surface Area (TPSA) | 62.10 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
![2D Structure of 9-(2,4-Dibromo-5-methoxyphenyl)-8-hydroxy-7-methyl-1,7-diazaspiro[4.4]non-1-en-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/9-24-dibromo-5-methoxyphenyl-8-hydroxy-7-methyl-17-diazaspiro44non-1-en-6-one.jpg "2D Structure of 9-(2,4-Dibromo-5-methoxyphenyl)-8-hydroxy-7-methyl-1,7-diazaspiro[4.4]non-1-en-6-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.85% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.32% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.03% | 93.99% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.74% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.27% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.21% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.89% | 90.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.17% | 89.62% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.22% | 97.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.04% | 86.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.54% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.90% | 95.89% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 85.51% | 95.53% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.30% | 91.11% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.01% | 91.07% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.87% | 90.71% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 84.49% | 85.49% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.31% | 98.75% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.40% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73836756 |
| LOTUS | LTS0076906 |
| wikiData | Q104949734 |