9-(2-Amino-2-deoxy-d-xylofuranosyl) adenine
| Internal ID | 0fe47bba-59a6-4e23-9a14-a3f80a54f214 |
| Taxonomy | Nucleosides, nucleotides, and analogues > Purine nucleosides > Purine 2-deoxyribonucleosides |
| IUPAC Name | 4-amino-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES (Canonical) | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)CO)O)N)N |
| SMILES (Isomeric) | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)CO)O)N)N |
| InChI | InChI=1S/C10H14N6O3/c11-5-7(18)4(1-17)19-10(5)16-3-15-6-8(12)13-2-14-9(6)16/h2-5,7,10,17-18H,1,11H2,(H2,12,13,14) |
| InChI Key | CQKMBZHLOYVGHW-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C10H14N6O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11273833 g/mol |
| Topological Polar Surface Area (TPSA) | 145.00 Ų |
| XlogP | -1.30 |
| NSC121182 |
| MLS000737527 |
| 4-amino-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| 24807-84-9 |
| 9H-Purin-6-amine, 9-(2-amino-2-deoxy-.beta.-D-xylofuranosyl)- |
| (2R,3S,4R,5R)-4-amino-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| NSC-121182 |
| JCI-2172 |
| NSC106047 |
| ADENOSINE,-2'-DEOXY |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3589 | P55263 | Adenosine kinase | 98.44% | 98.05% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.43% | 96.09% |
| CHEMBL3137261 | O14744 | PRMT5/MEP50 complex | 92.67% | 100.00% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 88.76% | 95.48% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.38% | 97.09% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 87.86% | 80.33% |
| CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 86.30% | 96.67% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.65% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.05% | 91.11% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.89% | 98.46% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.19% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.98% | 89.00% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 80.88% | 82.86% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 80.72% | 88.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 100053 |
| LOTUS | LTS0217541 |
| wikiData | Q72435554 |