9-(1,3-benzodioxol-5-yl)-4-methoxy-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one
Internal ID | 6875d7d0-8a74-4bef-87f1-4d9b7a3e12a3 |
Taxonomy | Lignans, neolignans and related compounds > Lignan lactones |
IUPAC Name | 9-(1,3-benzodioxol-5-yl)-4-methoxy-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
SMILES (Canonical) | COC1=C2CC3COC(=O)C3C(C2=CC4=C1OCO4)C5=CC6=C(C=C5)OCO6 |
SMILES (Isomeric) | COC1=C2CC3COC(=O)C3C(C2=CC4=C1OCO4)C5=CC6=C(C=C5)OCO6 |
InChI | InChI=1S/C21H18O7/c1-23-19-13-4-11-7-24-21(22)18(11)17(12(13)6-16-20(19)28-9-27-16)10-2-3-14-15(5-10)26-8-25-14/h2-3,5-6,11,17-18H,4,7-9H2,1H3 |
InChI Key | CCJWJASNEQOVDI-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H18O7 |
Molecular Weight | 382.40 g/mol |
Exact Mass | 382.10525291 g/mol |
Topological Polar Surface Area (TPSA) | 72.40 Ų |
XlogP | 3.20 |
There are no found synonyms. |
![2D Structure of 9-(1,3-benzodioxol-5-yl)-4-methoxy-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one 2D Structure of 9-(1,3-benzodioxol-5-yl)-4-methoxy-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one](https://plantaedb.com/storage/docs/compounds/2023/11/9-13-benzodioxol-5-yl-4-methoxy-5a68a9-tetrahydro-5h-2benzofuro65-f13benzodioxol-8-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.42% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.73% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.74% | 85.14% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.62% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.65% | 95.56% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 92.14% | 80.96% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.66% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.72% | 97.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.71% | 94.80% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.29% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.09% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.48% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 85.55% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 85.27% | 98.75% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.91% | 93.40% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.17% | 94.00% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 80.70% | 82.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bursera fagaroides |
Bursera graveolens |
PubChem | 72762427 |
LOTUS | LTS0073903 |
wikiData | Q103815898 |