(8S)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methyldecanamide
Internal ID | 2f631e7d-a346-4241-9d63-0e321cfcf284 |
Taxonomy | Benzenoids > Phenols > Methoxyphenols |
IUPAC Name | (8S)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methyldecanamide |
SMILES (Canonical) | CCC(C)CCCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
SMILES (Isomeric) | CC[C@H](C)CCCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
InChI | InChI=1S/C19H31NO3/c1-4-15(2)9-7-5-6-8-10-19(22)20-14-16-11-12-17(21)18(13-16)23-3/h11-13,15,21H,4-10,14H2,1-3H3,(H,20,22)/t15-/m0/s1 |
InChI Key | GOBFKCLUUUDTQE-HNNXBMFYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H31NO3 |
Molecular Weight | 321.50 g/mol |
Exact Mass | 321.23039385 g/mol |
Topological Polar Surface Area (TPSA) | 58.60 Ų |
XlogP | 5.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.12% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.92% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.63% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.14% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.35% | 94.45% |
CHEMBL2535 | P11166 | Glucose transporter | 93.76% | 98.75% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 92.49% | 90.20% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.12% | 97.29% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.10% | 90.71% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 87.19% | 90.24% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.03% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.93% | 95.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.55% | 96.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.49% | 95.17% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.06% | 97.21% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.78% | 100.00% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 83.41% | 96.25% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.15% | 92.88% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 82.15% | 96.67% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.82% | 94.73% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 80.51% | 89.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.13% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
PubChem | 163017424 |
LOTUS | LTS0195078 |
wikiData | Q105013661 |