(8S)-8-methyl-8-(4-methylpent-3-enyl)pyrano[2,3-f]chromen-2-one
| Internal ID | 357b3aec-7e3f-441d-8290-01b717197e20 |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Pyranocoumarins > Angular pyranocoumarins |
| IUPAC Name | (8S)-8-methyl-8-(4-methylpent-3-enyl)pyrano[2,3-f]chromen-2-one |
| SMILES (Canonical) | CC(=CCCC1(C=CC2=C(O1)C=CC3=C2OC(=O)C=C3)C)C |
| SMILES (Isomeric) | CC(=CCC[C@]1(C=CC2=C(O1)C=CC3=C2OC(=O)C=C3)C)C |
| InChI | InChI=1S/C19H20O3/c1-13(2)5-4-11-19(3)12-10-15-16(22-19)8-6-14-7-9-17(20)21-18(14)15/h5-10,12H,4,11H2,1-3H3/t19-/m0/s1 |
| InChI Key | JRANUCJGQJUYBB-IBGZPJMESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.14124450 g/mol |
| Topological Polar Surface Area (TPSA) | 35.50 Ų |
| XlogP | 4.80 |
| There are no found synonyms. |
![2D Structure of (8S)-8-methyl-8-(4-methylpent-3-enyl)pyrano[2,3-f]chromen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/8s-8-methyl-8-4-methylpent-3-enylpyrano23-fchromen-2-one.jpg "2D Structure of (8S)-8-methyl-8-(4-methylpent-3-enyl)pyrano[2,3-f]chromen-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 96.49% | 85.30% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.89% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.63% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.46% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.02% | 94.73% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 86.43% | 83.57% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.14% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.09% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.28% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.93% | 99.23% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.34% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Boronia lanceolata |
| PubChem | 162998471 |
| LOTUS | LTS0049540 |
| wikiData | Q105133790 |