(8S)-5,8-dihydroxy-8-(hydroxymethyl)-2-methyl-9H-pyrano[3,2-h][1]benzoxepin-4-one
Internal ID | 6189b6df-c5f5-4280-bce4-df900b35dd1b |
Taxonomy | Organoheterocyclic compounds > Benzoxepines |
IUPAC Name | (8S)-5,8-dihydroxy-8-(hydroxymethyl)-2-methyl-9H-pyrano[3,2-h][1]benzoxepin-4-one |
SMILES (Canonical) | CC1=CC(=O)C2=C(C3=C(C=C2O1)OCC(C=C3)(CO)O)O |
SMILES (Isomeric) | CC1=CC(=O)C2=C(C3=C(C=C2O1)OC[C@](C=C3)(CO)O)O |
InChI | InChI=1S/C15H14O6/c1-8-4-10(17)13-12(21-8)5-11-9(14(13)18)2-3-15(19,6-16)7-20-11/h2-5,16,18-19H,6-7H2,1H3/t15-/m0/s1 |
InChI Key | IVVDHMXDSFGHMC-HNNXBMFYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H14O6 |
Molecular Weight | 290.27 g/mol |
Exact Mass | 290.07903816 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 0.90 |
There are no found synonyms. |
![2D Structure of (8S)-5,8-dihydroxy-8-(hydroxymethyl)-2-methyl-9H-pyrano[3,2-h][1]benzoxepin-4-one 2D Structure of (8S)-5,8-dihydroxy-8-(hydroxymethyl)-2-methyl-9H-pyrano[3,2-h][1]benzoxepin-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/8s-58-dihydroxy-8-hydroxymethyl-2-methyl-9h-pyrano32-h1benzoxepin-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.21% | 89.63% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.05% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.07% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 96.21% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.97% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.23% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.65% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.61% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.39% | 94.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.13% | 89.34% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.31% | 86.33% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.53% | 90.24% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.41% | 96.77% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.81% | 90.71% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.53% | 94.80% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.00% | 100.00% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.21% | 85.11% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.17% | 94.42% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.44% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cedrelopsis grevei |
PubChem | 163040968 |
LOTUS | LTS0130884 |
wikiData | Q105121315 |