(8R)-8-[(E)-heptadec-13-enyl]-1,5,9,13-tetrazacycloheptadecan-6-one
Internal ID | c61c6522-57d8-49a6-be6c-c1ccb55fd255 |
Taxonomy | Organic acids and derivatives > Carboximidic acids and derivatives > Carboximidic acids > Cyclic carboximidic acids |
IUPAC Name | (8R)-8-[(E)-heptadec-13-enyl]-1,5,9,13-tetrazacycloheptadecan-6-one |
SMILES (Canonical) | CCCC=CCCCCCCCCCCCCC1CC(=O)NCCCNCCCCNCCCN1 |
SMILES (Isomeric) | CCC/C=C/CCCCCCCCCCCC[C@@H]1CC(=O)NCCCNCCCCNCCCN1 |
InChI | InChI=1S/C30H60N4O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-29-28-30(35)34-27-20-25-32-23-18-17-22-31-24-19-26-33-29/h4-5,29,31-33H,2-3,6-28H2,1H3,(H,34,35)/b5-4+/t29-/m1/s1 |
InChI Key | FDTSEFAHSFJXIX-NYTQBGBJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H60N4O |
Molecular Weight | 492.80 g/mol |
Exact Mass | 492.47671255 g/mol |
Topological Polar Surface Area (TPSA) | 65.20 Ų |
XlogP | 7.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.33% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.04% | 97.09% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.19% | 90.08% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 91.52% | 95.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.30% | 96.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.21% | 94.75% |
CHEMBL228 | P31645 | Serotonin transporter | 90.19% | 95.51% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 90.12% | 97.05% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.65% | 89.63% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.40% | 91.11% |
CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 88.77% | 94.55% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.72% | 89.34% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.53% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.27% | 99.17% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.88% | 93.99% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.84% | 97.79% |
CHEMBL2916 | O14746 | Telomerase reverse transcriptase | 82.60% | 90.00% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.22% | 92.88% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.88% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.85% | 89.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.44% | 92.50% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 80.40% | 92.97% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.21% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Albizia lebbeck |
PubChem | 163194890 |
LOTUS | LTS0273240 |
wikiData | Q104993798 |