(8R)-5-hydroxy-8-(4-hydroxyphenyl)-2,2-dimethyl-8,9-dihydro-7H-benzo[g]chromen-6-one
Internal ID | 0d858c3d-8cd0-4bd4-a1d3-ee3fcc460a76 |
Taxonomy | Benzenoids > Naphthalenes > Phenylnaphthalenes |
IUPAC Name | (8R)-5-hydroxy-8-(4-hydroxyphenyl)-2,2-dimethyl-8,9-dihydro-7H-benzo[g]chromen-6-one |
SMILES (Canonical) | CC1(C=CC2=C(O1)C=C3CC(CC(=O)C3=C2O)C4=CC=C(C=C4)O)C |
SMILES (Isomeric) | CC1(C=CC2=C(O1)C=C3C[C@H](CC(=O)C3=C2O)C4=CC=C(C=C4)O)C |
InChI | InChI=1S/C21H20O4/c1-21(2)8-7-16-18(25-21)11-14-9-13(10-17(23)19(14)20(16)24)12-3-5-15(22)6-4-12/h3-8,11,13,22,24H,9-10H2,1-2H3/t13-/m1/s1 |
InChI Key | LGIYTEOWZRHAKN-CYBMUJFWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O4 |
Molecular Weight | 336.40 g/mol |
Exact Mass | 336.13615911 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 4.20 |
There are no found synonyms. |
![2D Structure of (8R)-5-hydroxy-8-(4-hydroxyphenyl)-2,2-dimethyl-8,9-dihydro-7H-benzo[g]chromen-6-one 2D Structure of (8R)-5-hydroxy-8-(4-hydroxyphenyl)-2,2-dimethyl-8,9-dihydro-7H-benzo[g]chromen-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/8r-5-hydroxy-8-4-hydroxyphenyl-22-dimethyl-89-dihydro-7h-benzogchromen-6-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.14% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.61% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.40% | 94.45% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 92.93% | 85.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.28% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.06% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.72% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.06% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.83% | 91.49% |
CHEMBL236 | P41143 | Delta opioid receptor | 90.60% | 99.35% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.07% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.74% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.69% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.23% | 90.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.96% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.27% | 86.33% |
CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 82.50% | 80.00% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.34% | 93.10% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.81% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.67% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.55% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zygogynum pancheri |
PubChem | 24863960 |
LOTUS | LTS0125129 |
wikiData | Q105151379 |