(8R)-2-amino-8-methoxy-6,6-dimethyl-8,9-dihydro-7H-indeno[1,2-d]pyrimidin-5-one
| Internal ID | 00aa0157-b74d-4e47-b6a3-992afe858a35 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Aryl ketones |
| IUPAC Name | (8R)-2-amino-8-methoxy-6,6-dimethyl-8,9-dihydro-7H-indeno[1,2-d]pyrimidin-5-one |
| SMILES (Canonical) | CC1(CC(CC2=C1C(=O)C3=CN=C(N=C23)N)OC)C |
| SMILES (Isomeric) | CC1(C[C@H](CC2=C1C(=O)C3=CN=C(N=C23)N)OC)C |
| InChI | InChI=1S/C14H17N3O2/c1-14(2)5-7(19-3)4-8-10(14)12(18)9-6-16-13(15)17-11(8)9/h6-7H,4-5H2,1-3H3,(H2,15,16,17)/t7-/m0/s1 |
| InChI Key | QUIQOTTULIPJRU-ZETCQYMHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.132076794 g/mol |
| Topological Polar Surface Area (TPSA) | 78.10 Ų |
| XlogP | 0.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.80% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 95.53% | 94.75% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 92.96% | 85.30% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.80% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.99% | 92.94% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.74% | 94.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.21% | 91.49% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.84% | 95.89% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 89.00% | 95.69% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.96% | 85.14% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 87.90% | 96.67% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.51% | 99.23% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 86.02% | 98.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.57% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.09% | 91.11% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.85% | 100.00% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 84.45% | 91.23% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 84.42% | 99.18% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.41% | 82.69% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.22% | 92.68% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.14% | 86.33% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.78% | 97.33% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.65% | 96.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Millettia laurentii |
| PubChem | 163092053 |
| LOTUS | LTS0079977 |
| wikiData | Q105228207 |