(8R)-1,5,8-trimethyl-7,8-dihydro-6H-benzo[e][1]benzofuran-9-one
| Internal ID | 8e3a64fe-2069-41ac-872a-96375db4d84c |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (8R)-1,5,8-trimethyl-7,8-dihydro-6H-benzo[e][1]benzofuran-9-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H16O2/c1-8-4-5-11-9(2)6-12-13(10(3)7-17-12)14(11)15(8)16/h6-8H,4-5H2,1-3H3/t8-/m1/s1 |
| InChI Key | YBJIFGYQRRWWFW-MRVPVSSYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.115029749 g/mol |
| Topological Polar Surface Area (TPSA) | 30.20 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of (8R)-1,5,8-trimethyl-7,8-dihydro-6H-benzo[e][1]benzofuran-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/8r-158-trimethyl-78-dihydro-6h-benzoe1benzofuran-9-one.jpg "2D Structure of (8R)-1,5,8-trimethyl-7,8-dihydro-6H-benzo[e][1]benzofuran-9-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.02% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.80% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.29% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.97% | 89.00% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 88.58% | 86.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 86.01% | 93.65% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.78% | 99.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.06% | 90.71% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.94% | 93.40% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 81.54% | 96.25% |
| CHEMBL4444 | P04070 | Vitamin K-dependent protein C | 80.13% | 93.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.05% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Curcuma zedoaria |
| PubChem | 163028216 |
| LOTUS | LTS0194349 |
| wikiData | Q105345877 |