1,7-dihydroxy-3-methoxy-6-methyl-2,8-bis(4,5,6,7,8-pentahydroxy-2-methoxy-7-methyl-9,10-dioxo-6,8-dihydro-5H-anthracen-1-yl)anthracene-9,10-dione
| Internal ID | 745d06f7-df71-4dba-ac5a-51bb2bb2f7c2 |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones > Hydroxyanthraquinones |
| IUPAC Name | 1,7-dihydroxy-3-methoxy-6-methyl-2,8-bis(4,5,6,7,8-pentahydroxy-2-methoxy-7-methyl-9,10-dioxo-6,8-dihydro-5H-anthracen-1-yl)anthracene-9,10-dione |
| SMILES (Canonical) | CC1=CC2=C(C(=C1O)C3=C(C=C(C4=C3C(=O)C5=C(C4=O)C(C(C(C5O)(C)O)O)O)O)OC)C(=O)C6=C(C(=C(C=C6C2=O)OC)C7=C(C=C(C8=C7C(=O)C9=C(C8=O)C(C(C(C9O)(C)O)O)O)O)OC)O |
| SMILES (Isomeric) | CC1=CC2=C(C(=C1O)C3=C(C=C(C4=C3C(=O)C5=C(C4=O)C(C(C(C5O)(C)O)O)O)O)OC)C(=O)C6=C(C(=C(C=C6C2=O)OC)C7=C(C=C(C8=C7C(=O)C9=C(C8=O)C(C(C(C9O)(C)O)O)O)O)OC)O |
| InChI | InChI=1S/C48H40O21/c1-11-7-12-19(26(33(11)51)24-18(69-6)10-15(50)22-28(24)40(58)32-30(38(22)56)42(60)46(64)48(3,66)44(32)62)35(53)20-13(34(12)52)8-16(67-4)25(36(20)54)23-17(68-5)9-14(49)21-27(23)39(57)31-29(37(21)55)41(59)45(63)47(2,65)43(31)61/h7-10,41-46,49-51,54,59-66H,1-6H3 |
| InChI Key | PVDRYVWUAFTKGP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C48H40O21 |
| Molecular Weight | 952.80 g/mol |
| Exact Mass | 952.20620828 g/mol |
| Topological Polar Surface Area (TPSA) | 373.00 Ų |
| XlogP | -0.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.41% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.89% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.38% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.55% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.45% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.03% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.11% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.52% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.09% | 90.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.98% | 93.03% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.56% | 94.75% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.36% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.54% | 95.89% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.93% | 96.09% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.36% | 91.07% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.16% | 98.75% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.91% | 96.90% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.39% | 100.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.57% | 96.67% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.37% | 96.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.34% | 94.42% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.32% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163043832 |
| LOTUS | LTS0171867 |
| wikiData | Q104195457 |