(3S)-5-[[(2R,3S,4S,5R,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-6-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-8-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-hydroxy-3-methyl-5-oxopentanoic acid
| Internal ID | e5df6971-3df9-456a-a553-d4a9560cabcb |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-8-O-glycosides |
| IUPAC Name | (3S)-5-[[(2R,3S,4S,5R,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-6-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-8-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-hydroxy-3-methyl-5-oxopentanoic acid |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(C(=C3C(=C2O)C(=O)C=C(O3)C4=CC=C(C=C4)O)OC5C(C(C(C(O5)COC(=O)CC(C)(CC(=O)O)O)O)O)O)O)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=C(C(=C3C(=C2O)C(=O)C=C(O3)C4=CC=C(C=C4)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)COC(=O)C[C@](C)(CC(=O)O)O)O)O)O)O)O)O)O |
| InChI | InChI=1S/C33H38O20/c1-11-20(39)23(42)25(44)31(49-11)52-29-22(41)19-14(35)7-15(12-3-5-13(34)6-4-12)50-28(19)30(27(29)46)53-32-26(45)24(43)21(40)16(51-32)10-48-18(38)9-33(2,47)8-17(36)37/h3-7,11,16,20-21,23-26,31-32,34,39-47H,8-10H2,1-2H3,(H,36,37)/t11-,16+,20-,21+,23+,24-,25+,26+,31-,32-,33-/m0/s1 |
| InChI Key | CFZLCLAXQBWEHQ-LJNKWJCLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C33H38O20 |
| Molecular Weight | 754.60 g/mol |
| Exact Mass | 754.19564360 g/mol |
| Topological Polar Surface Area (TPSA) | 329.00 Ų |
| XlogP | -2.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.31% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.01% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.70% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.93% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.23% | 86.33% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 95.47% | 95.64% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.24% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.55% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.06% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.32% | 99.15% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 89.34% | 83.57% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.92% | 91.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.54% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.77% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.78% | 96.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.51% | 95.89% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 81.90% | 94.45% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.22% | 97.36% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.64% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163031399 |
| LOTUS | LTS0079116 |
| wikiData | Q104957305 |