Ac-Aib-DL-Pro-Aib-DL-Ala-Aib-Aib-DL-Gln-Aib-DL-xiIle-Aib-Gly-DL-Leu-Aib-DL-Pro-DL-Val-Aib-DL-Val-DL-Gln-DL-Gln-DL-Phe-ol
| Internal ID | ea354fd0-1f3b-40f8-a428-bc3ac1d54bbf |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | 2-[[2-[[2-[[2-[[2-[[1-[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[2-[[2-[[1-(2-acetamido-2-methylpropanoyl)pyrrolidine-2-carbonyl]amino]-2-methylpropanoyl]amino]propanoylamino]-2-methylpropanoyl]amino]-2-methylpropanoyl]amino]-5-amino-5-oxopentanoyl]amino]-2-methylpropanoyl]amino]-3-methylpentanoyl]amino]-2-methylpropanoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]-2-methylpropanoyl]amino]-3-methylbutanoyl]amino]-5-amino-5-oxopentanoyl]amino]-N-(1-hydroxy-3-phenylpropan-2-yl)pentanediamide |
| SMILES (Canonical) | CCC(C)C(C(=O)NC(C)(C)C(=O)NCC(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(C(C)C)C(=O)NC(C)(C)C(=O)NC(C(C)C)C(=O)NC(CCC(=O)N)C(=O)NC(CCC(=O)N)C(=O)NC(CC2=CC=CC=C2)CO)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C3CCCN3C(=O)C(C)(C)NC(=O)C |
| SMILES (Isomeric) | CCC(C)C(C(=O)NC(C)(C)C(=O)NCC(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(C(C)C)C(=O)NC(C)(C)C(=O)NC(C(C)C)C(=O)NC(CCC(=O)N)C(=O)NC(CCC(=O)N)C(=O)NC(CC2=CC=CC=C2)CO)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C3CCCN3C(=O)C(C)(C)NC(=O)C |
| InChI | InChI=1S/C95H157N23O24/c1-27-52(8)69(108-84(139)90(15,16)111-73(128)59(39-42-65(98)123)105-82(137)92(19,20)116-85(140)93(21,22)110-70(125)53(9)100-81(136)89(13,14)113-76(131)62-36-32-44-118(62)86(141)94(23,24)109-54(10)120)79(134)115-88(11,12)80(135)99-47-66(124)102-60(45-49(2)3)74(129)112-95(25,26)87(142)117-43-31-35-61(117)75(130)106-68(51(6)7)78(133)114-91(17,18)83(138)107-67(50(4)5)77(132)104-58(38-41-64(97)122)72(127)103-57(37-40-63(96)121)71(126)101-56(48-119)46-55-33-29-28-30-34-55/h28-30,33-34,49-53,56-62,67-69,119H,27,31-32,35-48H2,1-26H3,(H2,96,121)(H2,97,122)(H2,98,123)(H,99,135)(H,100,136)(H,101,126)(H,102,124)(H,103,127)(H,104,132)(H,105,137)(H,106,130)(H,107,138)(H,108,139)(H,109,120)(H,110,125)(H,111,128)(H,112,129)(H,113,131)(H,114,133)(H,115,134)(H,116,140) |
| InChI Key | DUEBOBVVVUDUEV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C95H157N23O24 |
| Molecular Weight | 2005.40 g/mol |
| Exact Mass | 2005.18053780 g/mol |
| Topological Polar Surface Area (TPSA) | 714.00 Ų |
| XlogP | -1.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.98% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.71% | 96.61% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.77% | 98.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.05% | 96.09% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 98.01% | 94.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.46% | 93.56% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 95.91% | 97.64% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 95.52% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 95.27% | 97.14% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 94.82% | 95.00% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 94.29% | 98.94% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 94.25% | 91.19% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.19% | 90.17% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 93.69% | 96.03% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 93.68% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.09% | 91.11% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 93.04% | 93.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.91% | 97.09% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 92.56% | 86.67% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 92.32% | 98.24% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.69% | 82.69% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.29% | 100.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 90.76% | 97.23% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 89.98% | 93.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.59% | 99.17% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.57% | 95.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.47% | 96.47% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 89.26% | 83.14% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.24% | 97.21% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.81% | 95.56% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 87.66% | 96.67% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 87.44% | 97.50% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 87.09% | 97.43% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 86.20% | 88.42% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 85.85% | 96.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.02% | 95.89% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.49% | 96.00% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 84.25% | 81.29% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.12% | 95.89% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.01% | 96.95% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 83.78% | 89.33% |
| CHEMBL5028 | O14672 | ADAM10 | 83.74% | 97.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.70% | 98.75% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.51% | 83.10% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.15% | 90.71% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.80% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139587339 |
| LOTUS | LTS0093451 |
| wikiData | Q77563656 |