8-[(5-Hydroxy-7-methoxy-9,10-dihydrophenanthren-2-yl)oxy]-6-methoxy-9,10-dihydrophenanthrene-2,5-diol
| Internal ID | 5eaedfd0-15d0-49ae-8cf8-a8349cb39ec5 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 8-[(5-hydroxy-7-methoxy-9,10-dihydrophenanthren-2-yl)oxy]-6-methoxy-9,10-dihydrophenanthrene-2,5-diol |
| SMILES (Canonical) | COC1=CC2=C(C3=C(CC2)C=C(C=C3)OC4=CC(=C(C5=C4CCC6=C5C=CC(=C6)O)O)OC)C(=C1)O |
| SMILES (Isomeric) | COC1=CC2=C(C3=C(CC2)C=C(C=C3)OC4=CC(=C(C5=C4CCC6=C5C=CC(=C6)O)O)OC)C(=C1)O |
| InChI | InChI=1S/C30H26O6/c1-34-21-13-18-4-3-17-12-20(7-10-22(17)28(18)25(32)14-21)36-26-15-27(35-2)30(33)29-23-9-6-19(31)11-16(23)5-8-24(26)29/h6-7,9-15,31-33H,3-5,8H2,1-2H3 |
| InChI Key | VZKMEMDCBSYFTF-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C30H26O6 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.17293854 g/mol |
| Topological Polar Surface Area (TPSA) | 88.40 Ų |
| XlogP | 6.20 |
| There are no found synonyms. |
![2D Structure of 8-[(5-Hydroxy-7-methoxy-9,10-dihydrophenanthren-2-yl)oxy]-6-methoxy-9,10-dihydrophenanthrene-2,5-diol](https://plantaedb.com/storage/docs/compounds/2023/11/8f646520-8806-11ee-8652-6d753a5c6038.jpg "2D Structure of 8-[(5-Hydroxy-7-methoxy-9,10-dihydrophenanthren-2-yl)oxy]-6-methoxy-9,10-dihydrophenanthrene-2,5-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.96% | 91.11% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 97.52% | 91.79% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 97.50% | 98.35% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.16% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.21% | 99.15% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.00% | 96.09% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 94.70% | 91.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.94% | 91.49% |
| CHEMBL5145 | P15056 | Serine/threonine-protein kinase B-raf | 92.36% | 97.90% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.83% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.48% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.83% | 94.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.64% | 95.89% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.45% | 95.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.14% | 98.75% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 87.95% | 92.68% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 87.75% | 82.67% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.41% | 98.95% |
| CHEMBL3194 | P02766 | Transthyretin | 86.97% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.71% | 99.17% |
| CHEMBL205 | P00918 | Carbonic anhydrase II | 86.38% | 98.44% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 85.11% | 96.09% |
| CHEMBL1293289 | P25440 | Bromodomain-containing protein 2 | 84.01% | 86.19% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.74% | 93.31% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 82.74% | 94.67% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.48% | 92.94% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.57% | 91.07% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 80.10% | 83.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pholidota chinensis |
| PubChem | 102026936 |
| LOTUS | LTS0113107 |
| wikiData | Q105299810 |