10-[6-[[4,5-Dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2-hydroxy-4,5,9,9,13,20,20-heptamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracos-16-en-23-one
Internal ID | 8f4aeaf7-d849-4f4e-be1b-b81c3b9df2b7 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | 10-[6-[[4,5-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2-hydroxy-4,5,9,9,13,20,20-heptamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracos-16-en-23-one |
SMILES (Canonical) | CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C3(CC(C26CC1OC6=O)O)C)C)(C)C)OC7C(C(C(C(O7)COC8C(C(C(CO8)O)O)OC9C(C(C(CO9)O)O)O)O)O)O)C)C |
SMILES (Isomeric) | CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C3(CC(C26CC1OC6=O)O)C)C)(C)C)OC7C(C(C(C(O7)COC8C(C(C(CO8)O)O)OC9C(C(C(CO9)O)O)O)O)O)O)C)C |
InChI | InChI=1S/C46H72O17/c1-41(2)14-21-20-8-9-26-43(5)12-11-28(42(3,4)25(43)10-13-44(26,6)45(20,7)15-27(49)46(21)16-29(41)62-40(46)56)61-38-35(55)33(53)32(52)24(60-38)19-59-39-36(31(51)23(48)18-58-39)63-37-34(54)30(50)22(47)17-57-37/h8,21-39,47-55H,9-19H2,1-7H3 |
InChI Key | PVLIPPHITNPLBJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H72O17 |
Molecular Weight | 897.10 g/mol |
Exact Mass | 896.47695082 g/mol |
Topological Polar Surface Area (TPSA) | 264.00 Ų |
XlogP | 0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.63% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.38% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.11% | 97.25% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.23% | 94.75% |
CHEMBL1871 | P10275 | Androgen Receptor | 92.18% | 96.43% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.18% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.87% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.28% | 94.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.74% | 97.36% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.37% | 96.77% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.08% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.07% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.58% | 94.45% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.58% | 92.50% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.55% | 95.93% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 85.34% | 97.78% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.75% | 92.62% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.37% | 95.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.00% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.47% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Albizia julibrissin |
Albizia lebbeck |
Archidendron molle |
PubChem | 73799307 |
LOTUS | LTS0181478 |
wikiData | Q105215498 |