(1R,8S,9S,16R)-8,16-bis(4-hydroxy-3-methoxyphenyl)tetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10(15),11,13-hexaene-4,6,12,14-tetrol
| Internal ID | 7be81bcf-715d-4311-9433-70fedad2aa89 |
| Taxonomy | Lignans, neolignans and related compounds > Aryltetralin lignans |
| IUPAC Name | (1R,8S,9S,16R)-8,16-bis(4-hydroxy-3-methoxyphenyl)tetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10(15),11,13-hexaene-4,6,12,14-tetrol |
| SMILES (Canonical) | COC1=C(C=CC(=C1)C2C3C(C4=C(C2C5=C3C=C(C=C5O)O)C=C(C=C4O)O)C6=CC(=C(C=C6)O)OC)O |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)[C@@H]2[C@H]3[C@H](C4=C([C@@H]2C5=C3C=C(C=C5O)O)C=C(C=C4O)O)C6=CC(=C(C=C6)O)OC)O |
| InChI | InChI=1S/C30H26O8/c1-37-23-7-13(3-5-19(23)33)25-27-17(9-15(31)11-21(27)35)30-26(14-4-6-20(34)24(8-14)38-2)29(25)18-10-16(32)12-22(36)28(18)30/h3-12,25-26,29-36H,1-2H3/t25-,26+,29+,30-/m0/s1 |
| InChI Key | JJWYSQXEIGBPJQ-MDULWEFBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H26O8 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.16276778 g/mol |
| Topological Polar Surface Area (TPSA) | 140.00 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
![2D Structure of (1R,8S,9S,16R)-8,16-bis(4-hydroxy-3-methoxyphenyl)tetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10(15),11,13-hexaene-4,6,12,14-tetrol](https://plantaedb.com/storage/docs/compounds/2023/11/8edaf780-8554-11ee-b008-fb0a0e6505eb.jpg "2D Structure of (1R,8S,9S,16R)-8,16-bis(4-hydroxy-3-methoxyphenyl)tetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10(15),11,13-hexaene-4,6,12,14-tetrol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.24% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.53% | 96.09% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 93.16% | 89.62% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.66% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.66% | 90.00% |
| CHEMBL3194 | P02766 | Transthyretin | 88.19% | 90.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.69% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.08% | 92.94% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 84.97% | 88.48% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.58% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.53% | 99.17% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 84.33% | 100.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.30% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.77% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.73% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.66% | 95.56% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 80.73% | 91.79% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 80.49% | 96.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gnetum gnemon |
| PubChem | 50918019 |
| LOTUS | LTS0082695 |
| wikiData | Q105130021 |