7-[[4,4,6a,6b,11,11,14b-heptamethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-2,3,4a,5,6,7,8,8a,9,10,12,12a,14,14a-tetradecahydro-1H-picen-3-yl]oxy]-2-(carboxymethoxy)-8-hydroxy-3-methoxy-2,4a,5,7,8,8a-hexahydropyrano[3,4-b][1,4]dioxine-3,5-dicarboxylic acid
| Internal ID | e9f44a6c-ea96-4541-9856-a12aa8195fd9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | 7-[[4,4,6a,6b,11,11,14b-heptamethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-2,3,4a,5,6,7,8,8a,9,10,12,12a,14,14a-tetradecahydro-1H-picen-3-yl]oxy]-2-(carboxymethoxy)-8-hydroxy-3-methoxy-2,4a,5,7,8,8a-hexahydropyrano[3,4-b][1,4]dioxine-3,5-dicarboxylic acid |
| SMILES (Canonical) | CC1(CC2C(CCC3(C2=CCC4C3(CCC5C4(CCC(C5(C)C)OC6C(C7C(C(O6)C(=O)O)OC(C(O7)OCC(=O)O)(C(=O)O)OC)O)C)C)C)C(C1)C(=O)OC8C(C(C(C(O8)CO)O)O)O)C |
| SMILES (Isomeric) | CC1(CC2C(CCC3(C2=CCC4C3(CCC5C4(CCC(C5(C)C)OC6C(C7C(C(O6)C(=O)O)OC(C(O7)OCC(=O)O)(C(=O)O)OC)O)C)C)C)C(C1)C(=O)OC8C(C(C(C(O8)CO)O)O)O)C |
| InChI | InChI=1S/C48H72O20/c1-43(2)17-22-21(23(18-43)38(58)67-39-32(54)31(53)30(52)25(19-49)63-39)11-15-46(6)24(22)9-10-27-45(5)14-13-28(44(3,4)26(45)12-16-47(27,46)7)64-40-33(55)34-35(36(65-40)37(56)57)68-48(61-8,41(59)60)42(66-34)62-20-29(50)51/h9,21-23,25-28,30-36,39-40,42,49,52-55H,10-20H2,1-8H3,(H,50,51)(H,56,57)(H,59,60) |
| InChI Key | AYLUYPJVLVVYOB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C48H72O20 |
| Molecular Weight | 969.10 g/mol |
| Exact Mass | 968.46169468 g/mol |
| Topological Polar Surface Area (TPSA) | 304.00 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.98% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.95% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.52% | 98.95% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.45% | 97.36% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.93% | 95.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.68% | 93.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.15% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.63% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.11% | 91.19% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.99% | 96.61% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.17% | 96.21% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.01% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.52% | 90.17% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.52% | 94.08% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.60% | 95.89% |
| CHEMBL5028 | O14672 | ADAM10 | 82.93% | 97.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.02% | 100.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.72% | 95.50% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.52% | 92.50% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 81.11% | 98.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163103441 |
| LOTUS | LTS0072291 |
| wikiData | Q104403538 |