[3,4,6-Trihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | a3dd8329-06a7-4f05-a7fd-2eb4bc3fd1bc |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [3,4,6-trihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC(=C(C=C1C=CC(=O)OCC2C(C(C(C(O2)O)OC3C(C(C(C(O3)CO)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1C=CC(=O)OCC2C(C(C(C(O2)O)OC3C(C(C(C(O3)CO)O)O)O)O)O)O)O |
InChI | InChI=1S/C21H28O14/c22-6-11-14(26)16(28)18(30)21(34-11)35-19-17(29)15(27)12(33-20(19)31)7-32-13(25)4-2-8-1-3-9(23)10(24)5-8/h1-5,11-12,14-24,26-31H,6-7H2 |
InChI Key | PXHNWJZYTYRGIL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H28O14 |
Molecular Weight | 504.40 g/mol |
Exact Mass | 504.14790556 g/mol |
Topological Polar Surface Area (TPSA) | 236.00 Ų |
XlogP | -2.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.69% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.11% | 91.49% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.87% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.84% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.60% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 93.29% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.77% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.16% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.41% | 94.73% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.87% | 95.93% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.38% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.20% | 86.92% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.74% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.74% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea batatas |
PubChem | 85388241 |
LOTUS | LTS0146045 |
wikiData | Q105216183 |