[(1R,2R,8R,9R,12S,13R,16S,18R)-1,2,8,13,17,17-hexamethyl-5-propan-2-yl-16-pentacyclo[10.8.0.02,9.04,8.013,18]icos-4-enyl] acetate
Internal ID | fdb0bb0d-c918-4083-bb22-0c3cb31c1329 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid esters |
IUPAC Name | [(1R,2R,8R,9R,12S,13R,16S,18R)-1,2,8,13,17,17-hexamethyl-5-propan-2-yl-16-pentacyclo[10.8.0.02,9.04,8.013,18]icos-4-enyl] acetate |
SMILES (Canonical) | CC(C)C1=C2CC3(C(C2(CC1)C)CCC4C3(CCC5C4(CCC(C5(C)C)OC(=O)C)C)C)C |
SMILES (Isomeric) | CC(C)C1=C2C[C@@]3([C@H]([C@]2(CC1)C)CC[C@@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OC(=O)C)C)C)C |
InChI | InChI=1S/C31H50O2/c1-19(2)21-12-15-28(6)22(21)18-31(9)24(28)10-11-25-29(7)16-14-26(33-20(3)32)27(4,5)23(29)13-17-30(25,31)8/h19,23-26H,10-18H2,1-9H3/t23-,24-,25-,26-,28-,29-,30+,31+/m0/s1 |
InChI Key | FXNLCNKEDWCEJN-ZFJMNYSJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H50O2 |
Molecular Weight | 454.70 g/mol |
Exact Mass | 454.381080833 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 8.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.92% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.78% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.47% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 91.92% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.81% | 91.19% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.12% | 82.69% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.03% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.22% | 97.25% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.15% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.06% | 93.56% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.91% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.08% | 92.62% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.96% | 100.00% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 81.44% | 92.95% |
CHEMBL5028 | O14672 | ADAM10 | 80.33% | 97.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.21% | 100.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.18% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Quercus gilva |
PubChem | 162892169 |
LOTUS | LTS0018595 |
wikiData | Q105004124 |